mirror of
https://github.com/mozilla/gecko-dev.git
synced 2024-11-02 07:05:24 +00:00
1722 lines
56 KiB
JavaScript
1722 lines
56 KiB
JavaScript
/* This Source Code Form is subject to the terms of the Mozilla Public
|
|
* License, v. 2.0. If a copy of the MPL was not distributed with this
|
|
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
|
|
|
|
"use strict";
|
|
|
|
const {Cu, Ci} = require("chrome");
|
|
const promise = require("promise");
|
|
const {Spectrum} = require("devtools/client/shared/widgets/Spectrum");
|
|
const {CubicBezierWidget} =
|
|
require("devtools/client/shared/widgets/CubicBezierWidget");
|
|
const {MdnDocsWidget} = require("devtools/client/shared/widgets/MdnDocsWidget");
|
|
const {CSSFilterEditorWidget} = require("devtools/client/shared/widgets/FilterWidget");
|
|
const EventEmitter = require("devtools/shared/event-emitter");
|
|
const {colorUtils} = require("devtools/shared/css-color");
|
|
const Heritage = require("sdk/core/heritage");
|
|
const {Eyedropper} = require("devtools/client/eyedropper/eyedropper");
|
|
const Editor = require("devtools/client/sourceeditor/editor");
|
|
|
|
loader.lazyRequireGetter(this, "beautify", "devtools/shared/jsbeautify/beautify");
|
|
|
|
Cu.import("resource://gre/modules/Services.jsm");
|
|
Cu.import("resource://gre/modules/XPCOMUtils.jsm");
|
|
|
|
XPCOMUtils.defineLazyModuleGetter(this, "setNamedTimeout",
|
|
"resource://devtools/client/shared/widgets/ViewHelpers.jsm");
|
|
XPCOMUtils.defineLazyModuleGetter(this, "clearNamedTimeout",
|
|
"resource://devtools/client/shared/widgets/ViewHelpers.jsm");
|
|
XPCOMUtils.defineLazyModuleGetter(this, "VariablesView",
|
|
"resource://devtools/client/shared/widgets/VariablesView.jsm");
|
|
XPCOMUtils.defineLazyModuleGetter(this, "VariablesViewController",
|
|
"resource://devtools/client/shared/widgets/VariablesViewController.jsm");
|
|
XPCOMUtils.defineLazyModuleGetter(this, "Task",
|
|
"resource://gre/modules/Task.jsm");
|
|
|
|
const XHTML_NS = "http://www.w3.org/1999/xhtml";
|
|
const SPECTRUM_FRAME = "chrome://devtools/content/shared/widgets/spectrum-frame.xhtml";
|
|
const CUBIC_BEZIER_FRAME =
|
|
"chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml";
|
|
const MDN_DOCS_FRAME = "chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml";
|
|
const FILTER_FRAME = "chrome://devtools/content/shared/widgets/filter-frame.xhtml";
|
|
const ESCAPE_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_ESCAPE;
|
|
const RETURN_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_RETURN;
|
|
const POPUP_EVENTS = ["shown", "hidden", "showing", "hiding"];
|
|
|
|
/**
|
|
* Tooltip widget.
|
|
*
|
|
* This widget is intended at any tool that may need to show rich content in the
|
|
* form of floating panels.
|
|
* A common use case is image previewing in the CSS rule view, but more complex
|
|
* use cases may include color pickers, object inspection, etc...
|
|
*
|
|
* Tooltips are based on XUL (namely XUL arrow-type <panel>s), and therefore
|
|
* need a XUL Document to live in.
|
|
* This is pretty much the only requirement they have on their environment.
|
|
*
|
|
* The way to use a tooltip is simply by instantiating a tooltip yourself and
|
|
* attaching some content in it, or using one of the ready-made content types.
|
|
*
|
|
* A convenient `startTogglingOnHover` method may avoid having to register event
|
|
* handlers yourself if the tooltip has to be shown when hovering over a
|
|
* specific element or group of elements (which is usually the most common case)
|
|
*/
|
|
|
|
/**
|
|
* Container used for dealing with optional parameters.
|
|
*
|
|
* @param {Object} defaults
|
|
* An object with all default options {p1: v1, p2: v2, ...}
|
|
* @param {Object} options
|
|
* The actual values.
|
|
*/
|
|
function OptionsStore(defaults, options) {
|
|
this.defaults = defaults || {};
|
|
this.options = options || {};
|
|
}
|
|
|
|
OptionsStore.prototype = {
|
|
/**
|
|
* Get the value for a given option name.
|
|
* @return {Object} Returns the value for that option, coming either for the
|
|
* actual values that have been set in the constructor, or from the
|
|
* defaults if that options was not specified.
|
|
*/
|
|
get: function(name) {
|
|
if (typeof this.options[name] !== "undefined") {
|
|
return this.options[name];
|
|
}
|
|
return this.defaults[name];
|
|
}
|
|
};
|
|
|
|
/**
|
|
* The low level structure of a tooltip is a XUL element (a <panel>).
|
|
*/
|
|
var PanelFactory = {
|
|
/**
|
|
* Get a new XUL panel instance.
|
|
* @param {XULDocument} doc
|
|
* The XUL document to put that panel into
|
|
* @param {OptionsStore} options
|
|
* An options store to get some configuration from
|
|
*/
|
|
get: function(doc, options) {
|
|
// Create the tooltip
|
|
let panel = doc.createElement("panel");
|
|
panel.setAttribute("hidden", true);
|
|
panel.setAttribute("ignorekeys", true);
|
|
panel.setAttribute("animate", false);
|
|
|
|
panel.setAttribute("consumeoutsideclicks",
|
|
options.get("consumeOutsideClick"));
|
|
panel.setAttribute("noautofocus", options.get("noAutoFocus"));
|
|
panel.setAttribute("type", "arrow");
|
|
panel.setAttribute("level", "top");
|
|
|
|
panel.setAttribute("class", "devtools-tooltip theme-tooltip-panel");
|
|
doc.querySelector("window").appendChild(panel);
|
|
|
|
return panel;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Tooltip class.
|
|
*
|
|
* Basic usage:
|
|
* let t = new Tooltip(xulDoc);
|
|
* t.content = someXulContent;
|
|
* t.show();
|
|
* t.hide();
|
|
* t.destroy();
|
|
*
|
|
* Better usage:
|
|
* let t = new Tooltip(xulDoc);
|
|
* t.startTogglingOnHover(container, target => {
|
|
* if (<condition based on target>) {
|
|
* t.setImageContent("http://image.png");
|
|
* return true;
|
|
* }
|
|
* });
|
|
* t.destroy();
|
|
*
|
|
* @param {XULDocument} doc
|
|
* The XUL document hosting this tooltip
|
|
* @param {Object} options
|
|
* Optional options that give options to consumers:
|
|
* - consumeOutsideClick {Boolean} Wether the first click outside of the
|
|
* tooltip should close the tooltip and be consumed or not.
|
|
* Defaults to false.
|
|
* - closeOnKeys {Array} An array of key codes that should close the
|
|
* tooltip. Defaults to [27] (escape key).
|
|
* - closeOnEvents [{emitter: {Object}, event: {String},
|
|
* useCapture: {Boolean}}]
|
|
* Provide an optional list of emitter objects and event names here to
|
|
* trigger the closing of the tooltip when these events are fired by the
|
|
* emitters. The emitter objects should either implement
|
|
* on/off(event, cb) or addEventListener/removeEventListener(event, cb).
|
|
* Defaults to [].
|
|
* For instance, the following would close the tooltip whenever the
|
|
* toolbox selects a new tool and when a DOM node gets scrolled:
|
|
* new Tooltip(doc, {
|
|
* closeOnEvents: [
|
|
* {emitter: toolbox, event: "select"},
|
|
* {emitter: myContainer, event: "scroll", useCapture: true}
|
|
* ]
|
|
* });
|
|
* - noAutoFocus {Boolean} Should the focus automatically go to the panel
|
|
* when it opens. Defaults to true.
|
|
*
|
|
* Fires these events:
|
|
* - showing : just before the tooltip shows
|
|
* - shown : when the tooltip is shown
|
|
* - hiding : just before the tooltip closes
|
|
* - hidden : when the tooltip gets hidden
|
|
* - keypress : when any key gets pressed, with keyCode
|
|
*/
|
|
function Tooltip(doc, options) {
|
|
EventEmitter.decorate(this);
|
|
|
|
this.doc = doc;
|
|
this.options = new OptionsStore({
|
|
consumeOutsideClick: false,
|
|
closeOnKeys: [ESCAPE_KEYCODE],
|
|
noAutoFocus: true,
|
|
closeOnEvents: []
|
|
}, options);
|
|
this.panel = PanelFactory.get(doc, this.options);
|
|
|
|
// Used for namedTimeouts in the mouseover handling
|
|
this.uid = "tooltip-" + Date.now();
|
|
|
|
// Emit show/hide events when the panel does.
|
|
for (let eventName of POPUP_EVENTS) {
|
|
this["_onPopup" + eventName] = (name => {
|
|
return e => {
|
|
if (e.target === this.panel) {
|
|
this.emit(name);
|
|
}
|
|
};
|
|
})(eventName);
|
|
this.panel.addEventListener("popup" + eventName,
|
|
this["_onPopup" + eventName], false);
|
|
}
|
|
|
|
// Listen to keypress events to close the tooltip if configured to do so
|
|
let win = this.doc.querySelector("window");
|
|
this._onKeyPress = event => {
|
|
if (this.panel.hidden) {
|
|
return;
|
|
}
|
|
|
|
this.emit("keypress", event.keyCode);
|
|
if (this.options.get("closeOnKeys").indexOf(event.keyCode) !== -1 &&
|
|
this.isShown()) {
|
|
event.stopPropagation();
|
|
this.hide();
|
|
}
|
|
};
|
|
win.addEventListener("keypress", this._onKeyPress, false);
|
|
|
|
// Listen to custom emitters' events to close the tooltip
|
|
this.hide = this.hide.bind(this);
|
|
let closeOnEvents = this.options.get("closeOnEvents");
|
|
for (let {emitter, event, useCapture} of closeOnEvents) {
|
|
for (let add of ["addEventListener", "on"]) {
|
|
if (add in emitter) {
|
|
emitter[add](event, this.hide, useCapture);
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
module.exports.Tooltip = Tooltip;
|
|
|
|
Tooltip.prototype = {
|
|
defaultPosition: "before_start",
|
|
// px
|
|
defaultOffsetX: 0,
|
|
// px
|
|
defaultOffsetY: 0,
|
|
// px
|
|
defaultShowDelay: 50,
|
|
|
|
/**
|
|
* Show the tooltip. It might be wise to append some content first if you
|
|
* don't want the tooltip to be empty. You may access the content of the
|
|
* tooltip by setting a XUL node to t.content.
|
|
* @param {node} anchor
|
|
* Which node should the tooltip be shown on
|
|
* @param {string} position [optional]
|
|
* Optional tooltip position. Defaults to before_start
|
|
* https://developer.mozilla.org/en-US/docs/XUL/PopupGuide/Positioning
|
|
* @param {number} x, y [optional]
|
|
* The left and top offset coordinates, in pixels.
|
|
*/
|
|
show: function(anchor,
|
|
position = this.defaultPosition,
|
|
x = this.defaultOffsetX,
|
|
y = this.defaultOffsetY) {
|
|
this.panel.hidden = false;
|
|
this.panel.openPopup(anchor, position, x, y);
|
|
},
|
|
|
|
/**
|
|
* Hide the tooltip
|
|
*/
|
|
hide: function() {
|
|
this.panel.hidden = true;
|
|
this.panel.hidePopup();
|
|
},
|
|
|
|
isShown: function() {
|
|
return this.panel &&
|
|
this.panel.state !== "closed" &&
|
|
this.panel.state !== "hiding";
|
|
},
|
|
|
|
setSize: function(width, height) {
|
|
this.panel.sizeTo(width, height);
|
|
},
|
|
|
|
/**
|
|
* Empty the tooltip's content
|
|
*/
|
|
empty: function() {
|
|
while (this.panel.hasChildNodes()) {
|
|
this.panel.removeChild(this.panel.firstChild);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Gets this panel's visibility state.
|
|
* @return boolean
|
|
*/
|
|
isHidden: function() {
|
|
return this.panel.state == "closed" || this.panel.state == "hiding";
|
|
},
|
|
|
|
/**
|
|
* Gets if this panel has any child nodes.
|
|
* @return boolean
|
|
*/
|
|
isEmpty: function() {
|
|
return !this.panel.hasChildNodes();
|
|
},
|
|
|
|
/**
|
|
* Get rid of references and event listeners
|
|
*/
|
|
destroy: function() {
|
|
this.hide();
|
|
|
|
for (let eventName of POPUP_EVENTS) {
|
|
this.panel.removeEventListener("popup" + eventName,
|
|
this["_onPopup" + eventName], false);
|
|
}
|
|
|
|
let win = this.doc.querySelector("window");
|
|
win.removeEventListener("keypress", this._onKeyPress, false);
|
|
|
|
let closeOnEvents = this.options.get("closeOnEvents");
|
|
for (let {emitter, event, useCapture} of closeOnEvents) {
|
|
for (let remove of ["removeEventListener", "off"]) {
|
|
if (remove in emitter) {
|
|
emitter[remove](event, this.hide, useCapture);
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
this.content = null;
|
|
|
|
if (this._basedNode) {
|
|
this.stopTogglingOnHover();
|
|
}
|
|
|
|
this.doc = null;
|
|
|
|
this.panel.remove();
|
|
this.panel = null;
|
|
},
|
|
|
|
/**
|
|
* Show/hide the tooltip when the mouse hovers over particular nodes.
|
|
*
|
|
* 2 Ways to make this work:
|
|
* - Provide a single node to attach the tooltip to, as the baseNode, and
|
|
* omit the second targetNodeCb argument
|
|
* - Provide a baseNode that is the container of possibly numerous children
|
|
* elements that may receive a tooltip. In this case, provide the second
|
|
* targetNodeCb argument to decide wether or not a child should receive
|
|
* a tooltip.
|
|
*
|
|
* This works by tracking mouse movements on a base container node (baseNode)
|
|
* and showing the tooltip when the mouse stops moving. The targetNodeCb
|
|
* callback is used to know whether or not the particular element being
|
|
* hovered over should indeed receive the tooltip. If you don't provide it
|
|
* it's equivalent to a function that always returns true.
|
|
*
|
|
* Note that if you call this function a second time, it will itself call
|
|
* stopTogglingOnHover before adding mouse tracking listeners again.
|
|
*
|
|
* @param {node} baseNode
|
|
* The container for all target nodes
|
|
* @param {Function} targetNodeCb
|
|
* A function that accepts a node argument and returns true or false
|
|
* (or a promise that resolves or rejects) to signify if the tooltip
|
|
* should be shown on that node or not.
|
|
* If the promise rejects, it must reject `false` as value.
|
|
* Any other value is going to be logged as unexpected error.
|
|
* Additionally, the function receives a second argument which is the
|
|
* tooltip instance itself, to be used to add/modify the content of the
|
|
* tooltip if needed. If omitted, the tooltip will be shown everytime.
|
|
* @param {Number} showDelay
|
|
* An optional delay that will be observed before showing the tooltip.
|
|
* Defaults to this.defaultShowDelay.
|
|
*/
|
|
startTogglingOnHover: function(baseNode, targetNodeCb,
|
|
showDelay=this.defaultShowDelay) {
|
|
if (this._basedNode) {
|
|
this.stopTogglingOnHover();
|
|
}
|
|
if (!baseNode) {
|
|
// Calling tool is in the process of being destroyed.
|
|
return;
|
|
}
|
|
|
|
this._basedNode = baseNode;
|
|
this._showDelay = showDelay;
|
|
this._targetNodeCb = targetNodeCb || (() => true);
|
|
|
|
this._onBaseNodeMouseMove = this._onBaseNodeMouseMove.bind(this);
|
|
this._onBaseNodeMouseLeave = this._onBaseNodeMouseLeave.bind(this);
|
|
|
|
baseNode.addEventListener("mousemove", this._onBaseNodeMouseMove, false);
|
|
baseNode.addEventListener("mouseleave", this._onBaseNodeMouseLeave, false);
|
|
},
|
|
|
|
/**
|
|
* If the startTogglingOnHover function has been used previously, and you want
|
|
* to get rid of this behavior, then call this function to remove the mouse
|
|
* movement tracking
|
|
*/
|
|
stopTogglingOnHover: function() {
|
|
clearNamedTimeout(this.uid);
|
|
|
|
if (!this._basedNode) {
|
|
return;
|
|
}
|
|
|
|
this._basedNode.removeEventListener("mousemove",
|
|
this._onBaseNodeMouseMove, false);
|
|
this._basedNode.removeEventListener("mouseleave",
|
|
this._onBaseNodeMouseLeave, false);
|
|
|
|
this._basedNode = null;
|
|
this._targetNodeCb = null;
|
|
this._lastHovered = null;
|
|
},
|
|
|
|
_onBaseNodeMouseMove: function(event) {
|
|
if (event.target !== this._lastHovered) {
|
|
this.hide();
|
|
this._lastHovered = event.target;
|
|
setNamedTimeout(this.uid, this._showDelay, () => {
|
|
this.isValidHoverTarget(event.target).then(target => {
|
|
this.show(target);
|
|
}, reason => {
|
|
if (reason === false) {
|
|
// isValidHoverTarget rejects with false if the tooltip should
|
|
// not be shown. This can be safely ignored.
|
|
return;
|
|
}
|
|
// Report everything else. Reason might be error that should not be
|
|
// hidden.
|
|
console.error("isValidHoverTarget rejected with an unexpected reason:");
|
|
console.error(reason);
|
|
});
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Is the given target DOMNode a valid node for toggling the tooltip on hover.
|
|
* This delegates to the user-defined _targetNodeCb callback.
|
|
* @return a promise that resolves or rejects depending if the tooltip should
|
|
* be shown or not. If it resolves, it does to the actual anchor to be used
|
|
*/
|
|
isValidHoverTarget: function(target) {
|
|
// Execute the user-defined callback which should return either true/false
|
|
// or a promise that resolves or rejects
|
|
let res = this._targetNodeCb(target, this);
|
|
|
|
// The callback can additionally return a DOMNode to replace the anchor of
|
|
// the tooltip when shown
|
|
if (res && res.then) {
|
|
return res.then(arg => {
|
|
return arg instanceof Ci.nsIDOMNode ? arg : target;
|
|
});
|
|
}
|
|
let newTarget = res instanceof Ci.nsIDOMNode ? res : target;
|
|
return res ? promise.resolve(newTarget) : promise.reject(false);
|
|
},
|
|
|
|
_onBaseNodeMouseLeave: function() {
|
|
clearNamedTimeout(this.uid);
|
|
this._lastHovered = null;
|
|
this.hide();
|
|
},
|
|
|
|
/**
|
|
* Set the content of this tooltip. Will first empty the tooltip and then
|
|
* append the new content element.
|
|
* Consider using one of the set<type>Content() functions instead.
|
|
* @param {node} content
|
|
* A node that can be appended in the tooltip XUL element
|
|
*/
|
|
set content(content) {
|
|
if (this.content == content) {
|
|
return;
|
|
}
|
|
|
|
this.empty();
|
|
this.panel.removeAttribute("clamped-dimensions");
|
|
this.panel.removeAttribute("clamped-dimensions-no-min-height");
|
|
this.panel.removeAttribute("clamped-dimensions-no-max-or-min-height");
|
|
this.panel.removeAttribute("wide");
|
|
|
|
if (content) {
|
|
this.panel.appendChild(content);
|
|
}
|
|
},
|
|
|
|
get content() {
|
|
return this.panel.firstChild;
|
|
},
|
|
|
|
/**
|
|
* Sets some text as the content of this tooltip.
|
|
*
|
|
* @param {array} messages
|
|
* A list of text messages.
|
|
* @param {string} messagesClass [optional]
|
|
* A style class for the text messages.
|
|
* @param {string} containerClass [optional]
|
|
* A style class for the text messages container.
|
|
* @param {boolean} isAlertTooltip [optional]
|
|
* Pass true to add an alert image for your tooltip.
|
|
*/
|
|
setTextContent: function(
|
|
{
|
|
messages,
|
|
messagesClass,
|
|
containerClass,
|
|
isAlertTooltip
|
|
},
|
|
extraButtons = []) {
|
|
messagesClass = messagesClass || "default-tooltip-simple-text-colors";
|
|
containerClass = containerClass || "default-tooltip-simple-text-colors";
|
|
|
|
let vbox = this.doc.createElement("vbox");
|
|
vbox.className = "devtools-tooltip-simple-text-container " + containerClass;
|
|
vbox.setAttribute("flex", "1");
|
|
|
|
for (let text of messages) {
|
|
let description = this.doc.createElement("description");
|
|
description.setAttribute("flex", "1");
|
|
description.className = "devtools-tooltip-simple-text " + messagesClass;
|
|
description.textContent = text;
|
|
vbox.appendChild(description);
|
|
}
|
|
|
|
for (let { label, className, command } of extraButtons) {
|
|
let button = this.doc.createElement("button");
|
|
button.className = className;
|
|
button.setAttribute("label", label);
|
|
button.addEventListener("command", command);
|
|
vbox.appendChild(button);
|
|
}
|
|
|
|
if (isAlertTooltip) {
|
|
let hbox = this.doc.createElement("hbox");
|
|
hbox.setAttribute("align", "start");
|
|
|
|
let alertImg = this.doc.createElement("image");
|
|
alertImg.className = "devtools-tooltip-alert-icon";
|
|
hbox.appendChild(alertImg);
|
|
hbox.appendChild(vbox);
|
|
this.content = hbox;
|
|
} else {
|
|
this.content = vbox;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets some event listener info as the content of this tooltip.
|
|
*
|
|
* @param {Object} (destructuring assignment)
|
|
* @0 {array} eventListenerInfos
|
|
* A list of event listeners.
|
|
* @1 {toolbox} toolbox
|
|
* Toolbox used to select debugger panel.
|
|
*/
|
|
setEventContent: function({ eventListenerInfos, toolbox }) {
|
|
new EventTooltip(this, eventListenerInfos, toolbox);
|
|
},
|
|
|
|
/**
|
|
* Fill the tooltip with a variables view, inspecting an object via its
|
|
* corresponding object actor, as specified in the remote debugging protocol.
|
|
*
|
|
* @param {object} objectActor
|
|
* The value grip for the object actor.
|
|
* @param {object} viewOptions [optional]
|
|
* Options for the variables view visualization.
|
|
* @param {object} controllerOptions [optional]
|
|
* Options for the variables view controller.
|
|
* @param {object} relayEvents [optional]
|
|
* A collection of events to listen on the variables view widget.
|
|
* For example, { fetched: () => ... }
|
|
* @param {boolean} reuseCachedWidget [optional]
|
|
* Pass false to instantiate a brand new widget for this variable.
|
|
* Otherwise, if a variable was previously inspected, its widget
|
|
* will be reused.
|
|
* @param {Toolbox} toolbox [optional]
|
|
* Pass the instance of the current toolbox if you want the variables
|
|
* view widget to allow highlighting and selection of DOM nodes
|
|
*/
|
|
setVariableContent: function(objectActor,
|
|
viewOptions = {},
|
|
controllerOptions = {},
|
|
relayEvents = {},
|
|
extraButtons = [],
|
|
toolbox = null) {
|
|
let vbox = this.doc.createElement("vbox");
|
|
vbox.className = "devtools-tooltip-variables-view-box";
|
|
vbox.setAttribute("flex", "1");
|
|
|
|
let innerbox = this.doc.createElement("vbox");
|
|
innerbox.className = "devtools-tooltip-variables-view-innerbox";
|
|
innerbox.setAttribute("flex", "1");
|
|
vbox.appendChild(innerbox);
|
|
|
|
for (let { label, className, command } of extraButtons) {
|
|
let button = this.doc.createElement("button");
|
|
button.className = className;
|
|
button.setAttribute("label", label);
|
|
button.addEventListener("command", command);
|
|
vbox.appendChild(button);
|
|
}
|
|
|
|
let widget = new VariablesView(innerbox, viewOptions);
|
|
|
|
// If a toolbox was provided, link it to the vview
|
|
if (toolbox) {
|
|
widget.toolbox = toolbox;
|
|
}
|
|
|
|
// Analyzing state history isn't useful with transient object inspectors.
|
|
widget.commitHierarchy = () => {};
|
|
|
|
for (let e in relayEvents) widget.on(e, relayEvents[e]);
|
|
VariablesViewController.attach(widget, controllerOptions);
|
|
|
|
// Some of the view options are allowed to change between uses.
|
|
widget.searchPlaceholder = viewOptions.searchPlaceholder;
|
|
widget.searchEnabled = viewOptions.searchEnabled;
|
|
|
|
// Use the object actor's grip to display it as a variable in the widget.
|
|
// The controller options are allowed to change between uses.
|
|
widget.controller.setSingleVariable(
|
|
{ objectActor: objectActor }, controllerOptions);
|
|
|
|
this.content = vbox;
|
|
this.panel.setAttribute("clamped-dimensions", "");
|
|
},
|
|
|
|
/**
|
|
* Uses the provided inspectorFront's getImageDataFromURL method to resolve
|
|
* the relative URL on the server-side, in the page context, and then sets the
|
|
* tooltip content with the resulting image just like |setImageContent| does.
|
|
* @return a promise that resolves when the image is shown in the tooltip or
|
|
* resolves when the broken image tooltip content is ready, but never rejects.
|
|
*/
|
|
setRelativeImageContent: Task.async(function*(imageUrl, inspectorFront,
|
|
maxDim) {
|
|
if (imageUrl.startsWith("data:")) {
|
|
// If the imageUrl already is a data-url, save ourselves a round-trip
|
|
this.setImageContent(imageUrl, {maxDim: maxDim});
|
|
} else if (inspectorFront) {
|
|
try {
|
|
let {data, size} = yield inspectorFront.getImageDataFromURL(imageUrl,
|
|
maxDim);
|
|
size.maxDim = maxDim;
|
|
let str = yield data.string();
|
|
this.setImageContent(str, size);
|
|
} catch (e) {
|
|
this.setBrokenImageContent();
|
|
}
|
|
}
|
|
}),
|
|
|
|
/**
|
|
* Fill the tooltip with a message explaining the the image is missing
|
|
*/
|
|
setBrokenImageContent: function() {
|
|
this.setTextContent({
|
|
messages: [l10n.strings.GetStringFromName("previewTooltip.image.brokenImage")]
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Fill the tooltip with an image and add the image dimension at the bottom.
|
|
*
|
|
* Only use this for absolute URLs that can be queried from the devtools
|
|
* client-side. For relative URLs, use |setRelativeImageContent|.
|
|
*
|
|
* @param {string} imageUrl
|
|
* The url to load the image from
|
|
* @param {Object} options
|
|
* The following options are supported:
|
|
* - resized : whether or not the image identified by imageUrl has been
|
|
* resized before this function was called.
|
|
* - naturalWidth/naturalHeight : the original size of the image before
|
|
* it was resized, if if was resized before this function was called.
|
|
* If not provided, will be measured on the loaded image.
|
|
* - maxDim : if the image should be resized before being shown, pass
|
|
* a number here.
|
|
* - hideDimensionLabel : if the dimension label should be appended
|
|
* after the image.
|
|
*/
|
|
setImageContent: function(imageUrl, options={}) {
|
|
if (!imageUrl) {
|
|
return;
|
|
}
|
|
|
|
// Main container
|
|
let vbox = this.doc.createElement("vbox");
|
|
vbox.setAttribute("align", "center");
|
|
|
|
// Display the image
|
|
let image = this.doc.createElement("image");
|
|
image.setAttribute("src", imageUrl);
|
|
if (options.maxDim) {
|
|
image.style.maxWidth = options.maxDim + "px";
|
|
image.style.maxHeight = options.maxDim + "px";
|
|
}
|
|
vbox.appendChild(image);
|
|
|
|
if (!options.hideDimensionLabel) {
|
|
let label = this.doc.createElement("label");
|
|
label.classList.add("devtools-tooltip-caption");
|
|
label.classList.add("theme-comment");
|
|
|
|
if (options.naturalWidth && options.naturalHeight) {
|
|
label.textContent = this._getImageDimensionLabel(options.naturalWidth,
|
|
options.naturalHeight);
|
|
} else {
|
|
// If no dimensions were provided, load the image to get them
|
|
label.textContent =
|
|
l10n.strings.GetStringFromName("previewTooltip.image.brokenImage");
|
|
let imgObj = new this.doc.defaultView.Image();
|
|
imgObj.src = imageUrl;
|
|
imgObj.onload = () => {
|
|
imgObj.onload = null;
|
|
label.textContent = this._getImageDimensionLabel(imgObj.naturalWidth,
|
|
imgObj.naturalHeight);
|
|
};
|
|
}
|
|
|
|
vbox.appendChild(label);
|
|
}
|
|
|
|
this.content = vbox;
|
|
},
|
|
|
|
_getImageDimensionLabel: (w, h) => w + " \u00D7 " + h,
|
|
|
|
/**
|
|
* Load a document into an iframe, and set the iframe
|
|
* to be the tooltip's content.
|
|
*
|
|
* Used by tooltips that want to load their interface
|
|
* into an iframe from a URL.
|
|
*
|
|
* @param {string} width
|
|
* Width of the iframe.
|
|
* @param {string} height
|
|
* Height of the iframe.
|
|
* @param {string} url
|
|
* URL of the document to load into the iframe.
|
|
*
|
|
* @return {promise} A promise which is resolved with
|
|
* the iframe.
|
|
*
|
|
* This function creates an iframe, loads the specified document
|
|
* into it, sets the tooltip's content to the iframe, and returns
|
|
* a promise.
|
|
*
|
|
* When the document is loaded, the function gets the content window
|
|
* and resolves the promise with the content window.
|
|
*/
|
|
setIFrameContent: function({width, height}, url) {
|
|
let def = promise.defer();
|
|
|
|
// Create an iframe
|
|
let iframe = this.doc.createElementNS(XHTML_NS, "iframe");
|
|
iframe.setAttribute("transparent", true);
|
|
iframe.setAttribute("width", width);
|
|
iframe.setAttribute("height", height);
|
|
iframe.setAttribute("flex", "1");
|
|
iframe.setAttribute("class", "devtools-tooltip-iframe");
|
|
|
|
// Wait for the load to initialize the widget
|
|
function onLoad() {
|
|
iframe.removeEventListener("load", onLoad, true);
|
|
def.resolve(iframe);
|
|
}
|
|
iframe.addEventListener("load", onLoad, true);
|
|
|
|
// load the document from url into the iframe
|
|
iframe.setAttribute("src", url);
|
|
|
|
// Put the iframe in the tooltip
|
|
this.content = iframe;
|
|
|
|
return def.promise;
|
|
},
|
|
|
|
/**
|
|
* Fill the tooltip with a new instance of the spectrum color picker widget
|
|
* initialized with the given color, and return a promise that resolves to
|
|
* the instance of spectrum
|
|
*/
|
|
setColorPickerContent: function(color) {
|
|
let dimensions = {width: "210", height: "216"};
|
|
let panel = this.panel;
|
|
return this.setIFrameContent(dimensions, SPECTRUM_FRAME).then(onLoaded);
|
|
|
|
function onLoaded(iframe) {
|
|
let win = iframe.contentWindow.wrappedJSObject;
|
|
let def = promise.defer();
|
|
let container = win.document.getElementById("spectrum");
|
|
let spectrum = new Spectrum(container, color);
|
|
|
|
function finalizeSpectrum() {
|
|
spectrum.show();
|
|
def.resolve(spectrum);
|
|
}
|
|
|
|
// Finalize spectrum's init when the tooltip becomes visible
|
|
if (panel.state == "open") {
|
|
finalizeSpectrum();
|
|
} else {
|
|
panel.addEventListener("popupshown", function shown() {
|
|
panel.removeEventListener("popupshown", shown, true);
|
|
finalizeSpectrum();
|
|
}, true);
|
|
}
|
|
return def.promise;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Fill the tooltip with a new instance of the cubic-bezier widget
|
|
* initialized with the given value, and return a promise that resolves to
|
|
* the instance of the widget
|
|
*/
|
|
setCubicBezierContent: function(bezier) {
|
|
let dimensions = {width: "410", height: "360"};
|
|
let panel = this.panel;
|
|
return this.setIFrameContent(dimensions, CUBIC_BEZIER_FRAME).then(onLoaded);
|
|
|
|
function onLoaded(iframe) {
|
|
let win = iframe.contentWindow.wrappedJSObject;
|
|
let def = promise.defer();
|
|
let container = win.document.getElementById("container");
|
|
let widget = new CubicBezierWidget(container, bezier);
|
|
|
|
// Resolve to the widget instance whenever the popup becomes visible
|
|
if (panel.state == "open") {
|
|
def.resolve(widget);
|
|
} else {
|
|
panel.addEventListener("popupshown", function shown() {
|
|
panel.removeEventListener("popupshown", shown, true);
|
|
def.resolve(widget);
|
|
}, true);
|
|
}
|
|
return def.promise;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Fill the tooltip with a new instance of the CSSFilterEditorWidget
|
|
* widget initialized with the given filter value, and return a promise
|
|
* that resolves to the instance of the widget when ready.
|
|
*/
|
|
setFilterContent: function(filter) {
|
|
let dimensions = {width: "500", height: "200"};
|
|
let panel = this.panel;
|
|
|
|
return this.setIFrameContent(dimensions, FILTER_FRAME).then(onLoaded);
|
|
|
|
function onLoaded(iframe) {
|
|
let win = iframe.contentWindow.wrappedJSObject;
|
|
let doc = win.document.documentElement;
|
|
let def = promise.defer();
|
|
let container = win.document.getElementById("container");
|
|
let widget = new CSSFilterEditorWidget(container, filter);
|
|
|
|
// Resolve to the widget instance whenever the popup becomes visible
|
|
if (panel.state === "open") {
|
|
def.resolve(widget);
|
|
} else {
|
|
panel.addEventListener("popupshown", function shown() {
|
|
panel.removeEventListener("popupshown", shown, true);
|
|
def.resolve(widget);
|
|
}, true);
|
|
}
|
|
return def.promise;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Set the content of the tooltip to display a font family preview.
|
|
* This is based on Lea Verou's Dablet.
|
|
* See https://github.com/LeaVerou/dabblet
|
|
* for more info.
|
|
* @param {String} font The font family value.
|
|
* @param {object} nodeFront
|
|
* The NodeActor that will used to retrieve the dataURL for the font
|
|
* family tooltip contents.
|
|
* @return A promise that resolves when the font tooltip content is ready, or
|
|
* rejects if no font is provided
|
|
*/
|
|
setFontFamilyContent: Task.async(function*(font, nodeFront) {
|
|
if (!font || !nodeFront) {
|
|
throw new Error("Missing font");
|
|
}
|
|
|
|
if (typeof nodeFront.getFontFamilyDataURL === "function") {
|
|
font = font.replace(/"/g, "'");
|
|
font = font.replace("!important", "");
|
|
font = font.trim();
|
|
|
|
let fillStyle =
|
|
(Services.prefs.getCharPref("devtools.theme") === "light") ?
|
|
"black" : "white";
|
|
|
|
let {data, size} = yield nodeFront.getFontFamilyDataURL(font, fillStyle);
|
|
let str = yield data.string();
|
|
this.setImageContent(str, { hideDimensionLabel: true, maxDim: size });
|
|
}
|
|
}),
|
|
|
|
/**
|
|
* Set the content of this tooltip to the MDN docs widget.
|
|
*
|
|
* This is called when the tooltip is first constructed.
|
|
*
|
|
* @return {promise} A promise which is resolved with an MdnDocsWidget.
|
|
*
|
|
* It loads the tooltip's structure from a separate XHTML file
|
|
* into an iframe. When the iframe is loaded it constructs
|
|
* an MdnDocsWidget and passes that into resolve.
|
|
*
|
|
* The caller can use the MdnDocsWidget to update the tooltip's
|
|
* UI with new content each time the tooltip is shown.
|
|
*/
|
|
setMdnDocsContent: function() {
|
|
let dimensions = {width: "410", height: "300"};
|
|
return this.setIFrameContent(dimensions, MDN_DOCS_FRAME).then(onLoaded);
|
|
|
|
function onLoaded(iframe) {
|
|
let win = iframe.contentWindow.wrappedJSObject;
|
|
// create an MdnDocsWidget, initializing it with the content document
|
|
let widget = new MdnDocsWidget(win.document);
|
|
return widget;
|
|
}
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Base class for all (color, gradient, ...)-swatch based value editors inside
|
|
* tooltips
|
|
*
|
|
* @param {XULDocument} doc
|
|
*/
|
|
function SwatchBasedEditorTooltip(doc) {
|
|
// Creating a tooltip instance
|
|
// This one will consume outside clicks as it makes more sense to let the user
|
|
// close the tooltip by clicking out
|
|
// It will also close on <escape> and <enter>
|
|
this.tooltip = new Tooltip(doc, {
|
|
consumeOutsideClick: true,
|
|
closeOnKeys: [ESCAPE_KEYCODE, RETURN_KEYCODE],
|
|
noAutoFocus: false
|
|
});
|
|
|
|
// By default, swatch-based editor tooltips revert value change on <esc> and
|
|
// commit value change on <enter>
|
|
this._onTooltipKeypress = (event, code) => {
|
|
if (code === ESCAPE_KEYCODE) {
|
|
this.revert();
|
|
} else if (code === RETURN_KEYCODE) {
|
|
this.commit();
|
|
}
|
|
};
|
|
this.tooltip.on("keypress", this._onTooltipKeypress);
|
|
|
|
// All target swatches are kept in a map, indexed by swatch DOM elements
|
|
this.swatches = new Map();
|
|
|
|
// When a swatch is clicked, and for as long as the tooltip is shown, the
|
|
// activeSwatch property will hold the reference to the swatch DOM element
|
|
// that was clicked
|
|
this.activeSwatch = null;
|
|
|
|
this._onSwatchClick = this._onSwatchClick.bind(this);
|
|
}
|
|
|
|
SwatchBasedEditorTooltip.prototype = {
|
|
show: function() {
|
|
if (this.activeSwatch) {
|
|
this.tooltip.show(this.activeSwatch, "topcenter bottomleft");
|
|
|
|
// When the tooltip is closed by clicking outside the panel we want to
|
|
// commit any changes. Because the "hidden" event destroys the tooltip we
|
|
// need to do this before the tooltip is destroyed (in the "hiding"
|
|
// event).
|
|
this.tooltip.once("hiding", () => {
|
|
if (!this._reverted && !this.eyedropperOpen) {
|
|
this.commit();
|
|
}
|
|
this._reverted = false;
|
|
});
|
|
|
|
// Once the tooltip is hidden we need to clean up any remaining objects.
|
|
this.tooltip.once("hidden", () => {
|
|
if (!this.eyedropperOpen) {
|
|
this.activeSwatch = null;
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
hide: function() {
|
|
this.tooltip.hide();
|
|
},
|
|
|
|
/**
|
|
* Add a new swatch DOM element to the list of swatch elements this editor
|
|
* tooltip knows about. That means from now on, clicking on that swatch will
|
|
* toggle the editor.
|
|
*
|
|
* @param {node} swatchEl
|
|
* The element to add
|
|
* @param {object} callbacks
|
|
* Callbacks that will be executed when the editor wants to preview a
|
|
* value change, or revert a change, or commit a change.
|
|
* - onShow: will be called when one of the swatch tooltip is shown
|
|
* - onPreview: will be called when one of the sub-classes calls
|
|
* preview
|
|
* - onRevert: will be called when the user ESCapes out of the tooltip
|
|
* - onCommit: will be called when the user presses ENTER or clicks
|
|
* outside the tooltip.
|
|
*/
|
|
addSwatch: function(swatchEl, callbacks={}) {
|
|
if (!callbacks.onShow) {
|
|
callbacks.onShow = function() {};
|
|
}
|
|
if (!callbacks.onPreview) {
|
|
callbacks.onPreview = function() {};
|
|
}
|
|
if (!callbacks.onRevert) {
|
|
callbacks.onRevert = function() {};
|
|
}
|
|
if (!callbacks.onCommit) {
|
|
callbacks.onCommit = function() {};
|
|
}
|
|
|
|
this.swatches.set(swatchEl, {
|
|
callbacks: callbacks
|
|
});
|
|
swatchEl.addEventListener("click", this._onSwatchClick, false);
|
|
},
|
|
|
|
removeSwatch: function(swatchEl) {
|
|
if (this.swatches.has(swatchEl)) {
|
|
if (this.activeSwatch === swatchEl) {
|
|
this.hide();
|
|
this.activeSwatch = null;
|
|
}
|
|
swatchEl.removeEventListener("click", this._onSwatchClick, false);
|
|
this.swatches.delete(swatchEl);
|
|
}
|
|
},
|
|
|
|
_onSwatchClick: function(event) {
|
|
let swatch = this.swatches.get(event.target);
|
|
|
|
if (event.shiftKey) {
|
|
event.stopPropagation();
|
|
return;
|
|
}
|
|
if (swatch) {
|
|
this.activeSwatch = event.target;
|
|
this.show();
|
|
swatch.callbacks.onShow();
|
|
event.stopPropagation();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Not called by this parent class, needs to be taken care of by sub-classes
|
|
*/
|
|
preview: function(value) {
|
|
if (this.activeSwatch) {
|
|
let swatch = this.swatches.get(this.activeSwatch);
|
|
swatch.callbacks.onPreview(value);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* This parent class only calls this on <esc> keypress
|
|
*/
|
|
revert: function() {
|
|
if (this.activeSwatch) {
|
|
let swatch = this.swatches.get(this.activeSwatch);
|
|
swatch.callbacks.onRevert();
|
|
this._reverted = true;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* This parent class only calls this on <enter> keypress
|
|
*/
|
|
commit: function() {
|
|
if (this.activeSwatch) {
|
|
let swatch = this.swatches.get(this.activeSwatch);
|
|
swatch.callbacks.onCommit();
|
|
}
|
|
},
|
|
|
|
destroy: function() {
|
|
this.swatches.clear();
|
|
this.activeSwatch = null;
|
|
this.tooltip.off("keypress", this._onTooltipKeypress);
|
|
this.tooltip.destroy();
|
|
}
|
|
};
|
|
|
|
/**
|
|
* The swatch color picker tooltip class is a specific class meant to be used
|
|
* along with output-parser's generated color swatches.
|
|
* It extends the parent SwatchBasedEditorTooltip class.
|
|
* It just wraps a standard Tooltip and sets its content with an instance of a
|
|
* color picker.
|
|
*
|
|
* @param {XULDocument} doc
|
|
*/
|
|
function SwatchColorPickerTooltip(doc) {
|
|
SwatchBasedEditorTooltip.call(this, doc);
|
|
|
|
// Creating a spectrum instance. this.spectrum will always be a promise that
|
|
// resolves to the spectrum instance
|
|
this.spectrum = this.tooltip.setColorPickerContent([0, 0, 0, 1]);
|
|
this._onSpectrumColorChange = this._onSpectrumColorChange.bind(this);
|
|
this._openEyeDropper = this._openEyeDropper.bind(this);
|
|
}
|
|
|
|
module.exports.SwatchColorPickerTooltip = SwatchColorPickerTooltip;
|
|
|
|
SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
|
|
/**
|
|
* Overriding the SwatchBasedEditorTooltip.show function to set spectrum's
|
|
* color.
|
|
*/
|
|
show: function() {
|
|
// Call then parent class' show function
|
|
SwatchBasedEditorTooltip.prototype.show.call(this);
|
|
// Then set spectrum's color and listen to color changes to preview them
|
|
if (this.activeSwatch) {
|
|
this.currentSwatchColor = this.activeSwatch.nextSibling;
|
|
this._originalColor = this.currentSwatchColor.textContent;
|
|
let color = this.activeSwatch.style.backgroundColor;
|
|
this.spectrum.then(spectrum => {
|
|
spectrum.off("changed", this._onSpectrumColorChange);
|
|
spectrum.rgb = this._colorToRgba(color);
|
|
spectrum.on("changed", this._onSpectrumColorChange);
|
|
spectrum.updateUI();
|
|
});
|
|
}
|
|
|
|
let tooltipDoc = this.tooltip.content.contentDocument;
|
|
let eyeButton = tooltipDoc.querySelector("#eyedropper-button");
|
|
eyeButton.addEventListener("click", this._openEyeDropper);
|
|
},
|
|
|
|
_onSpectrumColorChange: function(event, rgba, cssColor) {
|
|
this._selectColor(cssColor);
|
|
},
|
|
|
|
_selectColor: function(color) {
|
|
if (this.activeSwatch) {
|
|
this.activeSwatch.style.backgroundColor = color;
|
|
this.activeSwatch.parentNode.dataset.color = color;
|
|
|
|
color = this._toDefaultType(color);
|
|
this.currentSwatchColor.textContent = color;
|
|
this.preview(color);
|
|
|
|
if (this.eyedropperOpen) {
|
|
this.commit();
|
|
}
|
|
}
|
|
},
|
|
|
|
_openEyeDropper: function() {
|
|
let chromeWindow = this.tooltip.doc.defaultView.top;
|
|
let windowType = chromeWindow.document.documentElement
|
|
.getAttribute("windowtype");
|
|
let toolboxWindow;
|
|
if (windowType != "navigator:browser") {
|
|
// this means the toolbox is in a seperate window. We need to make
|
|
// sure we'll be inspecting the browser window instead
|
|
toolboxWindow = chromeWindow;
|
|
chromeWindow = Services.wm.getMostRecentWindow("navigator:browser");
|
|
chromeWindow.focus();
|
|
}
|
|
let dropper = new Eyedropper(chromeWindow, { copyOnSelect: false,
|
|
context: "picker" });
|
|
|
|
dropper.once("select", (event, color) => {
|
|
if (toolboxWindow) {
|
|
toolboxWindow.focus();
|
|
}
|
|
this._selectColor(color);
|
|
});
|
|
|
|
dropper.once("destroy", () => {
|
|
this.eyedropperOpen = false;
|
|
this.activeSwatch = null;
|
|
});
|
|
|
|
dropper.open();
|
|
this.eyedropperOpen = true;
|
|
|
|
// close the colorpicker tooltip so that only the eyedropper is open.
|
|
this.hide();
|
|
|
|
this.tooltip.emit("eyedropper-opened", dropper);
|
|
},
|
|
|
|
_colorToRgba: function(color) {
|
|
color = new colorUtils.CssColor(color);
|
|
let rgba = color._getRGBATuple();
|
|
return [rgba.r, rgba.g, rgba.b, rgba.a];
|
|
},
|
|
|
|
_toDefaultType: function(color) {
|
|
let colorObj = new colorUtils.CssColor(color);
|
|
colorObj.setAuthoredUnitFromColor(this._originalColor);
|
|
return colorObj.toString();
|
|
},
|
|
|
|
destroy: function() {
|
|
SwatchBasedEditorTooltip.prototype.destroy.call(this);
|
|
this.currentSwatchColor = null;
|
|
this.spectrum.then(spectrum => {
|
|
spectrum.off("changed", this._onSpectrumColorChange);
|
|
spectrum.destroy();
|
|
});
|
|
}
|
|
});
|
|
|
|
function EventTooltip(tooltip, eventListenerInfos, toolbox) {
|
|
this._tooltip = tooltip;
|
|
this._eventListenerInfos = eventListenerInfos;
|
|
this._toolbox = toolbox;
|
|
this._tooltip.eventEditors = new WeakMap();
|
|
|
|
this._headerClicked = this._headerClicked.bind(this);
|
|
this._debugClicked = this._debugClicked.bind(this);
|
|
this.destroy = this.destroy.bind(this);
|
|
|
|
this._init();
|
|
}
|
|
|
|
EventTooltip.prototype = {
|
|
_init: function() {
|
|
let config = {
|
|
mode: Editor.modes.js,
|
|
lineNumbers: false,
|
|
lineWrapping: false,
|
|
readOnly: true,
|
|
styleActiveLine: true,
|
|
extraKeys: {},
|
|
theme: "mozilla markup-view"
|
|
};
|
|
|
|
let doc = this._tooltip.doc;
|
|
let container = doc.createElement("vbox");
|
|
container.setAttribute("id", "devtools-tooltip-events-container");
|
|
|
|
for (let listener of this._eventListenerInfos) {
|
|
let phase = listener.capturing ? "Capturing" : "Bubbling";
|
|
let level = listener.DOM0 ? "DOM0" : "DOM2";
|
|
|
|
// Header
|
|
let header = doc.createElement("hbox");
|
|
header.className = "event-header devtools-toolbar";
|
|
container.appendChild(header);
|
|
|
|
if (!listener.hide.debugger) {
|
|
let debuggerIcon = doc.createElement("image");
|
|
debuggerIcon.className = "event-tooltip-debugger-icon";
|
|
debuggerIcon.setAttribute("src", "chrome://devtools/skin/themes/images/tool-debugger.svg");
|
|
let openInDebugger =
|
|
l10n.strings.GetStringFromName("eventsTooltip.openInDebugger");
|
|
debuggerIcon.setAttribute("tooltiptext", openInDebugger);
|
|
header.appendChild(debuggerIcon);
|
|
}
|
|
|
|
if (!listener.hide.type) {
|
|
let eventTypeLabel = doc.createElement("label");
|
|
eventTypeLabel.className = "event-tooltip-event-type";
|
|
eventTypeLabel.setAttribute("value", listener.type);
|
|
eventTypeLabel.setAttribute("tooltiptext", listener.type);
|
|
header.appendChild(eventTypeLabel);
|
|
}
|
|
|
|
if (!listener.hide.filename) {
|
|
let filename = doc.createElement("label");
|
|
filename.className = "event-tooltip-filename devtools-monospace";
|
|
filename.setAttribute("value", listener.origin);
|
|
filename.setAttribute("tooltiptext", listener.origin);
|
|
filename.setAttribute("crop", "left");
|
|
header.appendChild(filename);
|
|
}
|
|
|
|
let attributesContainer = doc.createElement("hbox");
|
|
attributesContainer.setAttribute("class",
|
|
"event-tooltip-attributes-container");
|
|
header.appendChild(attributesContainer);
|
|
|
|
if (!listener.hide.capturing) {
|
|
let attributesBox = doc.createElement("box");
|
|
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
|
|
attributesContainer.appendChild(attributesBox);
|
|
|
|
let capturing = doc.createElement("label");
|
|
capturing.className = "event-tooltip-attributes";
|
|
capturing.setAttribute("value", phase);
|
|
capturing.setAttribute("tooltiptext", phase);
|
|
attributesBox.appendChild(capturing);
|
|
}
|
|
|
|
if (listener.tags) {
|
|
for (let tag of listener.tags.split(",")) {
|
|
let attributesBox = doc.createElement("box");
|
|
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
|
|
attributesContainer.appendChild(attributesBox);
|
|
|
|
let tagBox = doc.createElement("label");
|
|
tagBox.className = "event-tooltip-attributes";
|
|
tagBox.setAttribute("value", tag);
|
|
tagBox.setAttribute("tooltiptext", tag);
|
|
attributesBox.appendChild(tagBox);
|
|
}
|
|
}
|
|
|
|
if (!listener.hide.dom0) {
|
|
let attributesBox = doc.createElement("box");
|
|
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
|
|
attributesContainer.appendChild(attributesBox);
|
|
|
|
let dom0 = doc.createElement("label");
|
|
dom0.className = "event-tooltip-attributes";
|
|
dom0.setAttribute("value", level);
|
|
dom0.setAttribute("tooltiptext", level);
|
|
attributesBox.appendChild(dom0);
|
|
}
|
|
|
|
// Content
|
|
let content = doc.createElement("box");
|
|
let editor = new Editor(config);
|
|
this._tooltip.eventEditors.set(content, {
|
|
editor: editor,
|
|
handler: listener.handler,
|
|
searchString: listener.searchString,
|
|
uri: listener.origin,
|
|
dom0: listener.DOM0,
|
|
appended: false
|
|
});
|
|
|
|
content.className = "event-tooltip-content-box";
|
|
container.appendChild(content);
|
|
|
|
this._addContentListeners(header);
|
|
}
|
|
|
|
this._tooltip.content = container;
|
|
this._tooltip.panel.setAttribute("clamped-dimensions-no-max-or-min-height",
|
|
"");
|
|
this._tooltip.panel.setAttribute("wide", "");
|
|
|
|
this._tooltip.panel.addEventListener("popuphiding", () => {
|
|
this.destroy(container);
|
|
}, false);
|
|
},
|
|
|
|
_addContentListeners: function(header) {
|
|
header.addEventListener("click", this._headerClicked);
|
|
},
|
|
|
|
_headerClicked: function(event) {
|
|
if (event.target.classList.contains("event-tooltip-debugger-icon")) {
|
|
this._debugClicked(event);
|
|
event.stopPropagation();
|
|
return;
|
|
}
|
|
|
|
let doc = this._tooltip.doc;
|
|
let header = event.currentTarget;
|
|
let content = header.nextElementSibling;
|
|
|
|
if (content.hasAttribute("open")) {
|
|
content.removeAttribute("open");
|
|
} else {
|
|
let contentNodes = doc.querySelectorAll(".event-tooltip-content-box");
|
|
|
|
for (let node of contentNodes) {
|
|
if (node !== content) {
|
|
node.removeAttribute("open");
|
|
}
|
|
}
|
|
|
|
content.setAttribute("open", "");
|
|
|
|
let eventEditors = this._tooltip.eventEditors.get(content);
|
|
|
|
if (eventEditors.appended) {
|
|
return;
|
|
}
|
|
|
|
let {editor, handler} = eventEditors;
|
|
|
|
let iframe = doc.createElement("iframe");
|
|
iframe.setAttribute("style", "width:100%;");
|
|
|
|
editor.appendTo(content, iframe).then(() => {
|
|
let tidied = beautify.js(handler, { indent_size: 2 });
|
|
|
|
editor.setText(tidied);
|
|
|
|
eventEditors.appended = true;
|
|
|
|
let container = header.parentElement.getBoundingClientRect();
|
|
if (header.getBoundingClientRect().top < container.top) {
|
|
header.scrollIntoView(true);
|
|
} else if (content.getBoundingClientRect().bottom > container.bottom) {
|
|
content.scrollIntoView(false);
|
|
}
|
|
|
|
this._tooltip.emit("event-tooltip-ready");
|
|
});
|
|
}
|
|
},
|
|
|
|
_debugClicked: function(event) {
|
|
let header = event.currentTarget;
|
|
let content = header.nextElementSibling;
|
|
|
|
let {uri, searchString, dom0} =
|
|
this._tooltip.eventEditors.get(content);
|
|
|
|
if (uri && uri !== "?") {
|
|
// Save a copy of toolbox as it will be set to null when we hide the
|
|
// tooltip.
|
|
let toolbox = this._toolbox;
|
|
|
|
this._tooltip.hide();
|
|
|
|
uri = uri.replace(/"/g, "");
|
|
|
|
let showSource = ({ DebuggerView }) => {
|
|
let matches = uri.match(/(.*):(\d+$)/);
|
|
let line = 1;
|
|
|
|
if (matches) {
|
|
uri = matches[1];
|
|
line = matches[2];
|
|
}
|
|
|
|
let item = DebuggerView.Sources.getItemForAttachment(
|
|
a => a.source.url === uri
|
|
);
|
|
if (item) {
|
|
let actor = item.attachment.source.actor;
|
|
DebuggerView.setEditorLocation(actor, line, {noDebug: true}).then(() => {
|
|
if (dom0) {
|
|
let text = DebuggerView.editor.getText();
|
|
let index = text.indexOf(searchString);
|
|
let lastIndex = text.lastIndexOf(searchString);
|
|
|
|
// To avoid confusion we only search for DOM0 event handlers when
|
|
// there is only one possible match in the file.
|
|
if (index !== -1 && index === lastIndex) {
|
|
text = text.substr(0, index);
|
|
let newlineMatches = text.match(/\n/g);
|
|
|
|
if (newlineMatches) {
|
|
DebuggerView.editor.setCursor({
|
|
line: newlineMatches.length
|
|
});
|
|
}
|
|
}
|
|
}
|
|
});
|
|
}
|
|
};
|
|
|
|
let debuggerAlreadyOpen = toolbox.getPanel("jsdebugger");
|
|
toolbox.selectTool("jsdebugger").then(({ panelWin: dbg }) => {
|
|
if (debuggerAlreadyOpen) {
|
|
showSource(dbg);
|
|
} else {
|
|
dbg.once(dbg.EVENTS.SOURCES_ADDED, () => showSource(dbg));
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
destroy: function(container) {
|
|
if (this._tooltip) {
|
|
this._tooltip.panel.removeEventListener("popuphiding", this.destroy,
|
|
false);
|
|
|
|
let boxes = container.querySelectorAll(".event-tooltip-content-box");
|
|
|
|
for (let box of boxes) {
|
|
let {editor} = this._tooltip.eventEditors.get(box);
|
|
editor.destroy();
|
|
}
|
|
|
|
this._tooltip.eventEditors.clear();
|
|
this._tooltip.eventEditors = null;
|
|
}
|
|
|
|
let headerNodes = container.querySelectorAll(".event-header");
|
|
|
|
for (let node of headerNodes) {
|
|
node.removeEventListener("click", this._headerClicked);
|
|
}
|
|
|
|
let sourceNodes =
|
|
container.querySelectorAll(".event-tooltip-debugger-icon");
|
|
for (let node of sourceNodes) {
|
|
node.removeEventListener("click", this._debugClicked);
|
|
}
|
|
|
|
this._eventListenerInfos = this._toolbox = this._tooltip = null;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* The swatch cubic-bezier tooltip class is a specific class meant to be used
|
|
* along with rule-view's generated cubic-bezier swatches.
|
|
* It extends the parent SwatchBasedEditorTooltip class.
|
|
* It just wraps a standard Tooltip and sets its content with an instance of a
|
|
* CubicBezierWidget.
|
|
*
|
|
* @param {XULDocument} doc
|
|
*/
|
|
function SwatchCubicBezierTooltip(doc) {
|
|
SwatchBasedEditorTooltip.call(this, doc);
|
|
|
|
// Creating a cubic-bezier instance.
|
|
// this.widget will always be a promise that resolves to the widget instance
|
|
this.widget = this.tooltip.setCubicBezierContent([0, 0, 1, 1]);
|
|
this._onUpdate = this._onUpdate.bind(this);
|
|
}
|
|
|
|
module.exports.SwatchCubicBezierTooltip = SwatchCubicBezierTooltip;
|
|
|
|
SwatchCubicBezierTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
|
|
/**
|
|
* Overriding the SwatchBasedEditorTooltip.show function to set the cubic
|
|
* bezier curve in the widget
|
|
*/
|
|
show: function() {
|
|
// Call the parent class' show function
|
|
SwatchBasedEditorTooltip.prototype.show.call(this);
|
|
// Then set the curve and listen to changes to preview them
|
|
if (this.activeSwatch) {
|
|
this.currentBezierValue = this.activeSwatch.nextSibling;
|
|
this.widget.then(widget => {
|
|
widget.off("updated", this._onUpdate);
|
|
widget.cssCubicBezierValue = this.currentBezierValue.textContent;
|
|
widget.on("updated", this._onUpdate);
|
|
});
|
|
}
|
|
},
|
|
|
|
_onUpdate: function(event, bezier) {
|
|
if (!this.activeSwatch) {
|
|
return;
|
|
}
|
|
|
|
this.currentBezierValue.textContent = bezier + "";
|
|
this.preview(bezier + "");
|
|
},
|
|
|
|
destroy: function() {
|
|
SwatchBasedEditorTooltip.prototype.destroy.call(this);
|
|
this.currentBezierValue = null;
|
|
this.widget.then(widget => {
|
|
widget.off("updated", this._onUpdate);
|
|
widget.destroy();
|
|
});
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Tooltip for displaying docs for CSS properties from MDN.
|
|
*
|
|
* @param {XULDocument} doc
|
|
*/
|
|
function CssDocsTooltip(doc) {
|
|
this.tooltip = new Tooltip(doc, {
|
|
consumeOutsideClick: true,
|
|
closeOnKeys: [ESCAPE_KEYCODE, RETURN_KEYCODE],
|
|
noAutoFocus: false
|
|
});
|
|
this.widget = this.tooltip.setMdnDocsContent();
|
|
}
|
|
|
|
module.exports.CssDocsTooltip = CssDocsTooltip;
|
|
|
|
CssDocsTooltip.prototype = {
|
|
/**
|
|
* Load CSS docs for the given property,
|
|
* then display the tooltip.
|
|
*/
|
|
show: function(anchor, propertyName) {
|
|
function loadCssDocs(widget) {
|
|
return widget.loadCssDocs(propertyName);
|
|
}
|
|
|
|
this.widget.then(loadCssDocs);
|
|
this.tooltip.show(anchor, "topcenter bottomleft");
|
|
},
|
|
|
|
hide: function() {
|
|
this.tooltip.hide();
|
|
},
|
|
|
|
destroy: function() {
|
|
this.tooltip.destroy();
|
|
}
|
|
};
|
|
|
|
/**
|
|
* The swatch-based css filter tooltip class is a specific class meant to be
|
|
* used along with rule-view's generated css filter swatches.
|
|
* It extends the parent SwatchBasedEditorTooltip class.
|
|
* It just wraps a standard Tooltip and sets its content with an instance of a
|
|
* CSSFilterEditorWidget.
|
|
*
|
|
* @param {XULDocument} doc
|
|
*/
|
|
function SwatchFilterTooltip(doc) {
|
|
SwatchBasedEditorTooltip.call(this, doc);
|
|
|
|
// Creating a filter editor instance.
|
|
// this.widget will always be a promise that resolves to the widget instance
|
|
this.widget = this.tooltip.setFilterContent("none");
|
|
this._onUpdate = this._onUpdate.bind(this);
|
|
}
|
|
|
|
exports.SwatchFilterTooltip = SwatchFilterTooltip;
|
|
|
|
SwatchFilterTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
|
|
show: function() {
|
|
// Call the parent class' show function
|
|
SwatchBasedEditorTooltip.prototype.show.call(this);
|
|
// Then set the filter value and listen to changes to preview them
|
|
if (this.activeSwatch) {
|
|
this.currentFilterValue = this.activeSwatch.nextSibling;
|
|
this.widget.then(widget => {
|
|
widget.off("updated", this._onUpdate);
|
|
widget.on("updated", this._onUpdate);
|
|
widget.setCssValue(this.currentFilterValue.textContent);
|
|
widget.render();
|
|
});
|
|
}
|
|
},
|
|
|
|
_onUpdate: function(event, filters) {
|
|
if (!this.activeSwatch) {
|
|
return;
|
|
}
|
|
|
|
// Remove the old children and reparse the property value to
|
|
// recompute them.
|
|
while (this.currentFilterValue.firstChild) {
|
|
this.currentFilterValue.firstChild.remove();
|
|
}
|
|
let node = this._parser.parseCssProperty("filter", filters, this._options);
|
|
this.currentFilterValue.appendChild(node);
|
|
|
|
this.preview();
|
|
},
|
|
|
|
destroy: function() {
|
|
SwatchBasedEditorTooltip.prototype.destroy.call(this);
|
|
this.currentFilterValue = null;
|
|
this.widget.then(widget => {
|
|
widget.off("updated", this._onUpdate);
|
|
widget.destroy();
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Like SwatchBasedEditorTooltip.addSwatch, but accepts a parser object
|
|
* to use when previewing the updated property value.
|
|
*
|
|
* @param {node} swatchEl
|
|
* @see SwatchBasedEditorTooltip.addSwatch
|
|
* @param {object} callbacks
|
|
* @see SwatchBasedEditorTooltip.addSwatch
|
|
* @param {object} parser
|
|
* A parser object; @see OutputParser object
|
|
* @param {object} options
|
|
* options to pass to the output parser, with
|
|
* the option |filterSwatch| set.
|
|
*/
|
|
addSwatch: function(swatchEl, callbacks, parser, options) {
|
|
SwatchBasedEditorTooltip.prototype.addSwatch.call(this, swatchEl,
|
|
callbacks);
|
|
this._parser = parser;
|
|
this._options = options;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* L10N utility class
|
|
*/
|
|
function L10N() {}
|
|
L10N.prototype = {};
|
|
|
|
var l10n = new L10N();
|
|
|
|
loader.lazyGetter(L10N.prototype, "strings", () => {
|
|
return Services.strings.createBundle(
|
|
"chrome://browser/locale/devtools/inspector.properties");
|
|
});
|