gecko-dev/devtools/client/shared/widgets/Tooltip.js

1724 lines
56 KiB
JavaScript

/* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
"use strict";
const {Cu, Ci} = require("chrome");
const promise = require("promise");
const {Spectrum} = require("devtools/client/shared/widgets/Spectrum");
const {CubicBezierWidget} =
require("devtools/client/shared/widgets/CubicBezierWidget");
const {MdnDocsWidget} = require("devtools/client/shared/widgets/MdnDocsWidget");
const {CSSFilterEditorWidget} = require("devtools/client/shared/widgets/FilterWidget");
const EventEmitter = require("devtools/shared/event-emitter");
const {colorUtils} = require("devtools/shared/css-color");
const Heritage = require("sdk/core/heritage");
const {Eyedropper} = require("devtools/client/eyedropper/eyedropper");
const Editor = require("devtools/client/sourceeditor/editor");
loader.lazyRequireGetter(this, "beautify", "devtools/shared/jsbeautify/beautify");
Cu.import("resource://gre/modules/Services.jsm");
Cu.import("resource://gre/modules/XPCOMUtils.jsm");
XPCOMUtils.defineLazyModuleGetter(this, "setNamedTimeout",
"resource://devtools/client/shared/widgets/ViewHelpers.jsm");
XPCOMUtils.defineLazyModuleGetter(this, "clearNamedTimeout",
"resource://devtools/client/shared/widgets/ViewHelpers.jsm");
XPCOMUtils.defineLazyModuleGetter(this, "VariablesView",
"resource://devtools/client/shared/widgets/VariablesView.jsm");
XPCOMUtils.defineLazyModuleGetter(this, "VariablesViewController",
"resource://devtools/client/shared/widgets/VariablesViewController.jsm");
XPCOMUtils.defineLazyModuleGetter(this, "Task",
"resource://gre/modules/Task.jsm");
const XHTML_NS = "http://www.w3.org/1999/xhtml";
const SPECTRUM_FRAME = "chrome://devtools/content/shared/widgets/spectrum-frame.xhtml";
const CUBIC_BEZIER_FRAME =
"chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml";
const MDN_DOCS_FRAME = "chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml";
const FILTER_FRAME = "chrome://devtools/content/shared/widgets/filter-frame.xhtml";
const ESCAPE_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_ESCAPE;
const RETURN_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_RETURN;
const POPUP_EVENTS = ["shown", "hidden", "showing", "hiding"];
/**
* Tooltip widget.
*
* This widget is intended at any tool that may need to show rich content in the
* form of floating panels.
* A common use case is image previewing in the CSS rule view, but more complex
* use cases may include color pickers, object inspection, etc...
*
* Tooltips are based on XUL (namely XUL arrow-type <panel>s), and therefore
* need a XUL Document to live in.
* This is pretty much the only requirement they have on their environment.
*
* The way to use a tooltip is simply by instantiating a tooltip yourself and
* attaching some content in it, or using one of the ready-made content types.
*
* A convenient `startTogglingOnHover` method may avoid having to register event
* handlers yourself if the tooltip has to be shown when hovering over a
* specific element or group of elements (which is usually the most common case)
*/
/**
* Container used for dealing with optional parameters.
*
* @param {Object} defaults
* An object with all default options {p1: v1, p2: v2, ...}
* @param {Object} options
* The actual values.
*/
function OptionsStore(defaults, options) {
this.defaults = defaults || {};
this.options = options || {};
}
OptionsStore.prototype = {
/**
* Get the value for a given option name.
* @return {Object} Returns the value for that option, coming either for the
* actual values that have been set in the constructor, or from the
* defaults if that options was not specified.
*/
get: function(name) {
if (typeof this.options[name] !== "undefined") {
return this.options[name];
}
return this.defaults[name];
}
};
/**
* The low level structure of a tooltip is a XUL element (a <panel>).
*/
var PanelFactory = {
/**
* Get a new XUL panel instance.
* @param {XULDocument} doc
* The XUL document to put that panel into
* @param {OptionsStore} options
* An options store to get some configuration from
*/
get: function(doc, options) {
// Create the tooltip
let panel = doc.createElement("panel");
panel.setAttribute("hidden", true);
panel.setAttribute("ignorekeys", true);
panel.setAttribute("animate", false);
panel.setAttribute("consumeoutsideclicks",
options.get("consumeOutsideClick"));
panel.setAttribute("noautofocus", options.get("noAutoFocus"));
panel.setAttribute("type", "arrow");
panel.setAttribute("level", "top");
panel.setAttribute("class", "devtools-tooltip theme-tooltip-panel");
doc.querySelector("window").appendChild(panel);
return panel;
}
};
/**
* Tooltip class.
*
* Basic usage:
* let t = new Tooltip(xulDoc);
* t.content = someXulContent;
* t.show();
* t.hide();
* t.destroy();
*
* Better usage:
* let t = new Tooltip(xulDoc);
* t.startTogglingOnHover(container, target => {
* if (<condition based on target>) {
* t.setImageContent("http://image.png");
* return true;
* }
* });
* t.destroy();
*
* @param {XULDocument} doc
* The XUL document hosting this tooltip
* @param {Object} options
* Optional options that give options to consumers:
* - consumeOutsideClick {Boolean} Wether the first click outside of the
* tooltip should close the tooltip and be consumed or not.
* Defaults to false.
* - closeOnKeys {Array} An array of key codes that should close the
* tooltip. Defaults to [27] (escape key).
* - closeOnEvents [{emitter: {Object}, event: {String},
* useCapture: {Boolean}}]
* Provide an optional list of emitter objects and event names here to
* trigger the closing of the tooltip when these events are fired by the
* emitters. The emitter objects should either implement
* on/off(event, cb) or addEventListener/removeEventListener(event, cb).
* Defaults to [].
* For instance, the following would close the tooltip whenever the
* toolbox selects a new tool and when a DOM node gets scrolled:
* new Tooltip(doc, {
* closeOnEvents: [
* {emitter: toolbox, event: "select"},
* {emitter: myContainer, event: "scroll", useCapture: true}
* ]
* });
* - noAutoFocus {Boolean} Should the focus automatically go to the panel
* when it opens. Defaults to true.
*
* Fires these events:
* - showing : just before the tooltip shows
* - shown : when the tooltip is shown
* - hiding : just before the tooltip closes
* - hidden : when the tooltip gets hidden
* - keypress : when any key gets pressed, with keyCode
*/
function Tooltip(doc, options) {
EventEmitter.decorate(this);
this.doc = doc;
this.options = new OptionsStore({
consumeOutsideClick: false,
closeOnKeys: [ESCAPE_KEYCODE],
noAutoFocus: true,
closeOnEvents: []
}, options);
this.panel = PanelFactory.get(doc, this.options);
// Used for namedTimeouts in the mouseover handling
this.uid = "tooltip-" + Date.now();
// Emit show/hide events when the panel does.
for (let eventName of POPUP_EVENTS) {
this["_onPopup" + eventName] = (name => {
return e => {
if (e.target === this.panel) {
this.emit(name);
}
};
})(eventName);
this.panel.addEventListener("popup" + eventName,
this["_onPopup" + eventName], false);
}
// Listen to keypress events to close the tooltip if configured to do so
let win = this.doc.querySelector("window");
this._onKeyPress = event => {
if (this.panel.hidden) {
return;
}
this.emit("keypress", event.keyCode);
if (this.options.get("closeOnKeys").indexOf(event.keyCode) !== -1 &&
this.isShown()) {
event.stopPropagation();
this.hide();
}
};
win.addEventListener("keypress", this._onKeyPress, false);
// Listen to custom emitters' events to close the tooltip
this.hide = this.hide.bind(this);
let closeOnEvents = this.options.get("closeOnEvents");
for (let {emitter, event, useCapture} of closeOnEvents) {
for (let add of ["addEventListener", "on"]) {
if (add in emitter) {
emitter[add](event, this.hide, useCapture);
break;
}
}
}
}
module.exports.Tooltip = Tooltip;
Tooltip.prototype = {
defaultPosition: "before_start",
// px
defaultOffsetX: 0,
// px
defaultOffsetY: 0,
// px
defaultShowDelay: 50,
/**
* Show the tooltip. It might be wise to append some content first if you
* don't want the tooltip to be empty. You may access the content of the
* tooltip by setting a XUL node to t.content.
* @param {node} anchor
* Which node should the tooltip be shown on
* @param {string} position [optional]
* Optional tooltip position. Defaults to before_start
* https://developer.mozilla.org/en-US/docs/XUL/PopupGuide/Positioning
* @param {number} x, y [optional]
* The left and top offset coordinates, in pixels.
*/
show: function(anchor,
position = this.defaultPosition,
x = this.defaultOffsetX,
y = this.defaultOffsetY) {
this.panel.hidden = false;
this.panel.openPopup(anchor, position, x, y);
},
/**
* Hide the tooltip
*/
hide: function() {
this.panel.hidden = true;
this.panel.hidePopup();
},
isShown: function() {
return this.panel &&
this.panel.state !== "closed" &&
this.panel.state !== "hiding";
},
setSize: function(width, height) {
this.panel.sizeTo(width, height);
},
/**
* Empty the tooltip's content
*/
empty: function() {
while (this.panel.hasChildNodes()) {
this.panel.removeChild(this.panel.firstChild);
}
},
/**
* Gets this panel's visibility state.
* @return boolean
*/
isHidden: function() {
return this.panel.state == "closed" || this.panel.state == "hiding";
},
/**
* Gets if this panel has any child nodes.
* @return boolean
*/
isEmpty: function() {
return !this.panel.hasChildNodes();
},
/**
* Get rid of references and event listeners
*/
destroy: function() {
this.hide();
for (let eventName of POPUP_EVENTS) {
this.panel.removeEventListener("popup" + eventName,
this["_onPopup" + eventName], false);
}
let win = this.doc.querySelector("window");
win.removeEventListener("keypress", this._onKeyPress, false);
let closeOnEvents = this.options.get("closeOnEvents");
for (let {emitter, event, useCapture} of closeOnEvents) {
for (let remove of ["removeEventListener", "off"]) {
if (remove in emitter) {
emitter[remove](event, this.hide, useCapture);
break;
}
}
}
this.content = null;
if (this._basedNode) {
this.stopTogglingOnHover();
}
this.doc = null;
this.panel.remove();
this.panel = null;
},
/**
* Show/hide the tooltip when the mouse hovers over particular nodes.
*
* 2 Ways to make this work:
* - Provide a single node to attach the tooltip to, as the baseNode, and
* omit the second targetNodeCb argument
* - Provide a baseNode that is the container of possibly numerous children
* elements that may receive a tooltip. In this case, provide the second
* targetNodeCb argument to decide wether or not a child should receive
* a tooltip.
*
* This works by tracking mouse movements on a base container node (baseNode)
* and showing the tooltip when the mouse stops moving. The targetNodeCb
* callback is used to know whether or not the particular element being
* hovered over should indeed receive the tooltip. If you don't provide it
* it's equivalent to a function that always returns true.
*
* Note that if you call this function a second time, it will itself call
* stopTogglingOnHover before adding mouse tracking listeners again.
*
* @param {node} baseNode
* The container for all target nodes
* @param {Function} targetNodeCb
* A function that accepts a node argument and returns true or false
* (or a promise that resolves or rejects) to signify if the tooltip
* should be shown on that node or not.
* If the promise rejects, it must reject `false` as value.
* Any other value is going to be logged as unexpected error.
* Additionally, the function receives a second argument which is the
* tooltip instance itself, to be used to add/modify the content of the
* tooltip if needed. If omitted, the tooltip will be shown everytime.
* @param {Number} showDelay
* An optional delay that will be observed before showing the tooltip.
* Defaults to this.defaultShowDelay.
*/
startTogglingOnHover: function(baseNode, targetNodeCb,
showDelay=this.defaultShowDelay) {
if (this._basedNode) {
this.stopTogglingOnHover();
}
if (!baseNode) {
// Calling tool is in the process of being destroyed.
return;
}
this._basedNode = baseNode;
this._showDelay = showDelay;
this._targetNodeCb = targetNodeCb || (() => true);
this._onBaseNodeMouseMove = this._onBaseNodeMouseMove.bind(this);
this._onBaseNodeMouseLeave = this._onBaseNodeMouseLeave.bind(this);
baseNode.addEventListener("mousemove", this._onBaseNodeMouseMove, false);
baseNode.addEventListener("mouseleave", this._onBaseNodeMouseLeave, false);
},
/**
* If the startTogglingOnHover function has been used previously, and you want
* to get rid of this behavior, then call this function to remove the mouse
* movement tracking
*/
stopTogglingOnHover: function() {
clearNamedTimeout(this.uid);
if (!this._basedNode) {
return;
}
this._basedNode.removeEventListener("mousemove",
this._onBaseNodeMouseMove, false);
this._basedNode.removeEventListener("mouseleave",
this._onBaseNodeMouseLeave, false);
this._basedNode = null;
this._targetNodeCb = null;
this._lastHovered = null;
},
_onBaseNodeMouseMove: function(event) {
if (event.target !== this._lastHovered) {
this.hide();
this._lastHovered = event.target;
setNamedTimeout(this.uid, this._showDelay, () => {
this.isValidHoverTarget(event.target).then(target => {
this.show(target);
}, reason => {
if (reason === false) {
// isValidHoverTarget rejects with false if the tooltip should
// not be shown. This can be safely ignored.
return;
}
// Report everything else. Reason might be error that should not be
// hidden.
console.error("isValidHoverTarget rejected with an unexpected reason:");
console.error(reason);
});
});
}
},
/**
* Is the given target DOMNode a valid node for toggling the tooltip on hover.
* This delegates to the user-defined _targetNodeCb callback.
* @return a promise that resolves or rejects depending if the tooltip should
* be shown or not. If it resolves, it does to the actual anchor to be used
*/
isValidHoverTarget: function(target) {
// Execute the user-defined callback which should return either true/false
// or a promise that resolves or rejects
let res = this._targetNodeCb(target, this);
// The callback can additionally return a DOMNode to replace the anchor of
// the tooltip when shown
if (res && res.then) {
return res.then(arg => {
return arg instanceof Ci.nsIDOMNode ? arg : target;
});
}
let newTarget = res instanceof Ci.nsIDOMNode ? res : target;
return res ? promise.resolve(newTarget) : promise.reject(false);
},
_onBaseNodeMouseLeave: function() {
clearNamedTimeout(this.uid);
this._lastHovered = null;
this.hide();
},
/**
* Set the content of this tooltip. Will first empty the tooltip and then
* append the new content element.
* Consider using one of the set<type>Content() functions instead.
* @param {node} content
* A node that can be appended in the tooltip XUL element
*/
set content(content) {
if (this.content == content) {
return;
}
this.empty();
this.panel.removeAttribute("clamped-dimensions");
this.panel.removeAttribute("clamped-dimensions-no-min-height");
this.panel.removeAttribute("clamped-dimensions-no-max-or-min-height");
this.panel.removeAttribute("wide");
if (content) {
this.panel.appendChild(content);
}
},
get content() {
return this.panel.firstChild;
},
/**
* Sets some text as the content of this tooltip.
*
* @param {array} messages
* A list of text messages.
* @param {string} messagesClass [optional]
* A style class for the text messages.
* @param {string} containerClass [optional]
* A style class for the text messages container.
* @param {boolean} isAlertTooltip [optional]
* Pass true to add an alert image for your tooltip.
*/
setTextContent: function(
{
messages,
messagesClass,
containerClass,
isAlertTooltip
},
extraButtons = []) {
messagesClass = messagesClass || "default-tooltip-simple-text-colors";
containerClass = containerClass || "default-tooltip-simple-text-colors";
let vbox = this.doc.createElement("vbox");
vbox.className = "devtools-tooltip-simple-text-container " + containerClass;
vbox.setAttribute("flex", "1");
for (let text of messages) {
let description = this.doc.createElement("description");
description.setAttribute("flex", "1");
description.className = "devtools-tooltip-simple-text " + messagesClass;
description.textContent = text;
vbox.appendChild(description);
}
for (let { label, className, command } of extraButtons) {
let button = this.doc.createElement("button");
button.className = className;
button.setAttribute("label", label);
button.addEventListener("command", command);
vbox.appendChild(button);
}
if (isAlertTooltip) {
let hbox = this.doc.createElement("hbox");
hbox.setAttribute("align", "start");
let alertImg = this.doc.createElement("image");
alertImg.className = "devtools-tooltip-alert-icon";
hbox.appendChild(alertImg);
hbox.appendChild(vbox);
this.content = hbox;
} else {
this.content = vbox;
}
},
/**
* Sets some event listener info as the content of this tooltip.
*
* @param {Object} (destructuring assignment)
* @0 {array} eventListenerInfos
* A list of event listeners.
* @1 {toolbox} toolbox
* Toolbox used to select debugger panel.
*/
setEventContent: function({ eventListenerInfos, toolbox }) {
new EventTooltip(this, eventListenerInfos, toolbox);
},
/**
* Fill the tooltip with a variables view, inspecting an object via its
* corresponding object actor, as specified in the remote debugging protocol.
*
* @param {object} objectActor
* The value grip for the object actor.
* @param {object} viewOptions [optional]
* Options for the variables view visualization.
* @param {object} controllerOptions [optional]
* Options for the variables view controller.
* @param {object} relayEvents [optional]
* A collection of events to listen on the variables view widget.
* For example, { fetched: () => ... }
* @param {boolean} reuseCachedWidget [optional]
* Pass false to instantiate a brand new widget for this variable.
* Otherwise, if a variable was previously inspected, its widget
* will be reused.
* @param {Toolbox} toolbox [optional]
* Pass the instance of the current toolbox if you want the variables
* view widget to allow highlighting and selection of DOM nodes
*/
setVariableContent: function(objectActor,
viewOptions = {},
controllerOptions = {},
relayEvents = {},
extraButtons = [],
toolbox = null) {
let vbox = this.doc.createElement("vbox");
vbox.className = "devtools-tooltip-variables-view-box";
vbox.setAttribute("flex", "1");
let innerbox = this.doc.createElement("vbox");
innerbox.className = "devtools-tooltip-variables-view-innerbox";
innerbox.setAttribute("flex", "1");
vbox.appendChild(innerbox);
for (let { label, className, command } of extraButtons) {
let button = this.doc.createElement("button");
button.className = className;
button.setAttribute("label", label);
button.addEventListener("command", command);
vbox.appendChild(button);
}
let widget = new VariablesView(innerbox, viewOptions);
// If a toolbox was provided, link it to the vview
if (toolbox) {
widget.toolbox = toolbox;
}
// Analyzing state history isn't useful with transient object inspectors.
widget.commitHierarchy = () => {};
for (let e in relayEvents) widget.on(e, relayEvents[e]);
VariablesViewController.attach(widget, controllerOptions);
// Some of the view options are allowed to change between uses.
widget.searchPlaceholder = viewOptions.searchPlaceholder;
widget.searchEnabled = viewOptions.searchEnabled;
// Use the object actor's grip to display it as a variable in the widget.
// The controller options are allowed to change between uses.
widget.controller.setSingleVariable(
{ objectActor: objectActor }, controllerOptions);
this.content = vbox;
this.panel.setAttribute("clamped-dimensions", "");
},
/**
* Uses the provided inspectorFront's getImageDataFromURL method to resolve
* the relative URL on the server-side, in the page context, and then sets the
* tooltip content with the resulting image just like |setImageContent| does.
* @return a promise that resolves when the image is shown in the tooltip or
* resolves when the broken image tooltip content is ready, but never rejects.
*/
setRelativeImageContent: Task.async(function*(imageUrl, inspectorFront,
maxDim) {
if (imageUrl.startsWith("data:")) {
// If the imageUrl already is a data-url, save ourselves a round-trip
this.setImageContent(imageUrl, {maxDim: maxDim});
} else if (inspectorFront) {
try {
let {data, size} = yield inspectorFront.getImageDataFromURL(imageUrl,
maxDim);
size.maxDim = maxDim;
let str = yield data.string();
this.setImageContent(str, size);
} catch (e) {
this.setBrokenImageContent();
}
}
}),
/**
* Fill the tooltip with a message explaining the the image is missing
*/
setBrokenImageContent: function() {
this.setTextContent({
messages: [l10n.strings.GetStringFromName("previewTooltip.image.brokenImage")]
});
},
/**
* Fill the tooltip with an image and add the image dimension at the bottom.
*
* Only use this for absolute URLs that can be queried from the devtools
* client-side. For relative URLs, use |setRelativeImageContent|.
*
* @param {string} imageUrl
* The url to load the image from
* @param {Object} options
* The following options are supported:
* - resized : whether or not the image identified by imageUrl has been
* resized before this function was called.
* - naturalWidth/naturalHeight : the original size of the image before
* it was resized, if if was resized before this function was called.
* If not provided, will be measured on the loaded image.
* - maxDim : if the image should be resized before being shown, pass
* a number here.
* - hideDimensionLabel : if the dimension label should be appended
* after the image.
*/
setImageContent: function(imageUrl, options={}) {
if (!imageUrl) {
return;
}
// Main container
let vbox = this.doc.createElement("vbox");
vbox.setAttribute("align", "center");
// Display the image
let image = this.doc.createElement("image");
image.setAttribute("src", imageUrl);
if (options.maxDim) {
image.style.maxWidth = options.maxDim + "px";
image.style.maxHeight = options.maxDim + "px";
}
vbox.appendChild(image);
if (!options.hideDimensionLabel) {
let label = this.doc.createElement("label");
label.classList.add("devtools-tooltip-caption");
label.classList.add("theme-comment");
if (options.naturalWidth && options.naturalHeight) {
label.textContent = this._getImageDimensionLabel(options.naturalWidth,
options.naturalHeight);
} else {
// If no dimensions were provided, load the image to get them
label.textContent =
l10n.strings.GetStringFromName("previewTooltip.image.brokenImage");
let imgObj = new this.doc.defaultView.Image();
imgObj.src = imageUrl;
imgObj.onload = () => {
imgObj.onload = null;
label.textContent = this._getImageDimensionLabel(imgObj.naturalWidth,
imgObj.naturalHeight);
};
}
vbox.appendChild(label);
}
this.content = vbox;
},
_getImageDimensionLabel: (w, h) => w + " \u00D7 " + h,
/**
* Load a document into an iframe, and set the iframe
* to be the tooltip's content.
*
* Used by tooltips that want to load their interface
* into an iframe from a URL.
*
* @param {string} width
* Width of the iframe.
* @param {string} height
* Height of the iframe.
* @param {string} url
* URL of the document to load into the iframe.
*
* @return {promise} A promise which is resolved with
* the iframe.
*
* This function creates an iframe, loads the specified document
* into it, sets the tooltip's content to the iframe, and returns
* a promise.
*
* When the document is loaded, the function gets the content window
* and resolves the promise with the content window.
*/
setIFrameContent: function({width, height}, url) {
let def = promise.defer();
// Create an iframe
let iframe = this.doc.createElementNS(XHTML_NS, "iframe");
iframe.setAttribute("transparent", true);
iframe.setAttribute("width", width);
iframe.setAttribute("height", height);
iframe.setAttribute("flex", "1");
iframe.setAttribute("class", "devtools-tooltip-iframe");
// Wait for the load to initialize the widget
function onLoad() {
iframe.removeEventListener("load", onLoad, true);
def.resolve(iframe);
}
iframe.addEventListener("load", onLoad, true);
// load the document from url into the iframe
iframe.setAttribute("src", url);
// Put the iframe in the tooltip
this.content = iframe;
return def.promise;
},
/**
* Fill the tooltip with a new instance of the spectrum color picker widget
* initialized with the given color, and return a promise that resolves to
* the instance of spectrum
*/
setColorPickerContent: function(color) {
let dimensions = {width: "210", height: "216"};
let panel = this.panel;
return this.setIFrameContent(dimensions, SPECTRUM_FRAME).then(onLoaded);
function onLoaded(iframe) {
let win = iframe.contentWindow.wrappedJSObject;
let def = promise.defer();
let container = win.document.getElementById("spectrum");
let spectrum = new Spectrum(container, color);
function finalizeSpectrum() {
spectrum.show();
def.resolve(spectrum);
}
// Finalize spectrum's init when the tooltip becomes visible
if (panel.state == "open") {
finalizeSpectrum();
} else {
panel.addEventListener("popupshown", function shown() {
panel.removeEventListener("popupshown", shown, true);
finalizeSpectrum();
}, true);
}
return def.promise;
}
},
/**
* Fill the tooltip with a new instance of the cubic-bezier widget
* initialized with the given value, and return a promise that resolves to
* the instance of the widget
*/
setCubicBezierContent: function(bezier) {
let dimensions = {width: "410", height: "360"};
let panel = this.panel;
return this.setIFrameContent(dimensions, CUBIC_BEZIER_FRAME).then(onLoaded);
function onLoaded(iframe) {
let win = iframe.contentWindow.wrappedJSObject;
let def = promise.defer();
let container = win.document.getElementById("container");
let widget = new CubicBezierWidget(container, bezier);
// Resolve to the widget instance whenever the popup becomes visible
if (panel.state == "open") {
def.resolve(widget);
} else {
panel.addEventListener("popupshown", function shown() {
panel.removeEventListener("popupshown", shown, true);
def.resolve(widget);
}, true);
}
return def.promise;
}
},
/**
* Fill the tooltip with a new instance of the CSSFilterEditorWidget
* widget initialized with the given filter value, and return a promise
* that resolves to the instance of the widget when ready.
*/
setFilterContent: function(filter) {
let dimensions = {width: "500", height: "200"};
let panel = this.panel;
return this.setIFrameContent(dimensions, FILTER_FRAME).then(onLoaded);
function onLoaded(iframe) {
let win = iframe.contentWindow.wrappedJSObject;
let doc = win.document.documentElement;
let def = promise.defer();
let container = win.document.getElementById("container");
let widget = new CSSFilterEditorWidget(container, filter);
// Resolve to the widget instance whenever the popup becomes visible
if (panel.state === "open") {
def.resolve(widget);
} else {
panel.addEventListener("popupshown", function shown() {
panel.removeEventListener("popupshown", shown, true);
def.resolve(widget);
}, true);
}
return def.promise;
}
},
/**
* Set the content of the tooltip to display a font family preview.
* This is based on Lea Verou's Dablet.
* See https://github.com/LeaVerou/dabblet
* for more info.
* @param {String} font The font family value.
* @param {object} nodeFront
* The NodeActor that will used to retrieve the dataURL for the font
* family tooltip contents.
* @return A promise that resolves when the font tooltip content is ready, or
* rejects if no font is provided
*/
setFontFamilyContent: Task.async(function*(font, nodeFront) {
if (!font || !nodeFront) {
throw new Error("Missing font");
}
if (typeof nodeFront.getFontFamilyDataURL === "function") {
font = font.replace(/"/g, "'");
font = font.replace("!important", "");
font = font.trim();
let fillStyle =
(Services.prefs.getCharPref("devtools.theme") === "light") ?
"black" : "white";
let {data, size} = yield nodeFront.getFontFamilyDataURL(font, fillStyle);
let str = yield data.string();
this.setImageContent(str, { hideDimensionLabel: true, maxDim: size });
}
}),
/**
* Set the content of this tooltip to the MDN docs widget.
*
* This is called when the tooltip is first constructed.
*
* @return {promise} A promise which is resolved with an MdnDocsWidget.
*
* It loads the tooltip's structure from a separate XHTML file
* into an iframe. When the iframe is loaded it constructs
* an MdnDocsWidget and passes that into resolve.
*
* The caller can use the MdnDocsWidget to update the tooltip's
* UI with new content each time the tooltip is shown.
*/
setMdnDocsContent: function() {
let dimensions = {width: "410", height: "300"};
return this.setIFrameContent(dimensions, MDN_DOCS_FRAME).then(onLoaded);
function onLoaded(iframe) {
let win = iframe.contentWindow.wrappedJSObject;
// create an MdnDocsWidget, initializing it with the content document
let widget = new MdnDocsWidget(win.document);
return widget;
}
}
};
/**
* Base class for all (color, gradient, ...)-swatch based value editors inside
* tooltips
*
* @param {XULDocument} doc
*/
function SwatchBasedEditorTooltip(doc) {
// Creating a tooltip instance
// This one will consume outside clicks as it makes more sense to let the user
// close the tooltip by clicking out
// It will also close on <escape> and <enter>
this.tooltip = new Tooltip(doc, {
consumeOutsideClick: true,
closeOnKeys: [ESCAPE_KEYCODE, RETURN_KEYCODE],
noAutoFocus: false
});
// By default, swatch-based editor tooltips revert value change on <esc> and
// commit value change on <enter>
this._onTooltipKeypress = (event, code) => {
if (code === ESCAPE_KEYCODE) {
this.revert();
} else if (code === RETURN_KEYCODE) {
this.commit();
}
};
this.tooltip.on("keypress", this._onTooltipKeypress);
// All target swatches are kept in a map, indexed by swatch DOM elements
this.swatches = new Map();
// When a swatch is clicked, and for as long as the tooltip is shown, the
// activeSwatch property will hold the reference to the swatch DOM element
// that was clicked
this.activeSwatch = null;
this._onSwatchClick = this._onSwatchClick.bind(this);
}
SwatchBasedEditorTooltip.prototype = {
show: function() {
if (this.activeSwatch) {
this.tooltip.show(this.activeSwatch, "topcenter bottomleft");
// When the tooltip is closed by clicking outside the panel we want to
// commit any changes. Because the "hidden" event destroys the tooltip we
// need to do this before the tooltip is destroyed (in the "hiding"
// event).
this.tooltip.once("hiding", () => {
if (!this._reverted && !this.eyedropperOpen) {
this.commit();
}
this._reverted = false;
});
// Once the tooltip is hidden we need to clean up any remaining objects.
this.tooltip.once("hidden", () => {
if (!this.eyedropperOpen) {
this.activeSwatch = null;
}
});
}
},
hide: function() {
this.tooltip.hide();
},
/**
* Add a new swatch DOM element to the list of swatch elements this editor
* tooltip knows about. That means from now on, clicking on that swatch will
* toggle the editor.
*
* @param {node} swatchEl
* The element to add
* @param {object} callbacks
* Callbacks that will be executed when the editor wants to preview a
* value change, or revert a change, or commit a change.
* - onShow: will be called when one of the swatch tooltip is shown
* - onPreview: will be called when one of the sub-classes calls
* preview
* - onRevert: will be called when the user ESCapes out of the tooltip
* - onCommit: will be called when the user presses ENTER or clicks
* outside the tooltip.
*/
addSwatch: function(swatchEl, callbacks={}) {
if (!callbacks.onShow) {
callbacks.onShow = function() {};
}
if (!callbacks.onPreview) {
callbacks.onPreview = function() {};
}
if (!callbacks.onRevert) {
callbacks.onRevert = function() {};
}
if (!callbacks.onCommit) {
callbacks.onCommit = function() {};
}
this.swatches.set(swatchEl, {
callbacks: callbacks
});
swatchEl.addEventListener("click", this._onSwatchClick, false);
},
removeSwatch: function(swatchEl) {
if (this.swatches.has(swatchEl)) {
if (this.activeSwatch === swatchEl) {
this.hide();
this.activeSwatch = null;
}
swatchEl.removeEventListener("click", this._onSwatchClick, false);
this.swatches.delete(swatchEl);
}
},
_onSwatchClick: function(event) {
let swatch = this.swatches.get(event.target);
if (event.shiftKey) {
event.stopPropagation();
return;
}
if (swatch) {
this.activeSwatch = event.target;
this.show();
swatch.callbacks.onShow();
event.stopPropagation();
}
},
/**
* Not called by this parent class, needs to be taken care of by sub-classes
*/
preview: function(value) {
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
swatch.callbacks.onPreview(value);
}
},
/**
* This parent class only calls this on <esc> keypress
*/
revert: function() {
if (this.activeSwatch) {
this._reverted = true;
let swatch = this.swatches.get(this.activeSwatch);
this.tooltip.once("hiding", () => {
swatch.callbacks.onRevert();
});
}
},
/**
* This parent class only calls this on <enter> keypress
*/
commit: function() {
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
swatch.callbacks.onCommit();
}
},
destroy: function() {
this.swatches.clear();
this.activeSwatch = null;
this.tooltip.off("keypress", this._onTooltipKeypress);
this.tooltip.destroy();
}
};
/**
* The swatch color picker tooltip class is a specific class meant to be used
* along with output-parser's generated color swatches.
* It extends the parent SwatchBasedEditorTooltip class.
* It just wraps a standard Tooltip and sets its content with an instance of a
* color picker.
*
* @param {XULDocument} doc
*/
function SwatchColorPickerTooltip(doc) {
SwatchBasedEditorTooltip.call(this, doc);
// Creating a spectrum instance. this.spectrum will always be a promise that
// resolves to the spectrum instance
this.spectrum = this.tooltip.setColorPickerContent([0, 0, 0, 1]);
this._onSpectrumColorChange = this._onSpectrumColorChange.bind(this);
this._openEyeDropper = this._openEyeDropper.bind(this);
}
module.exports.SwatchColorPickerTooltip = SwatchColorPickerTooltip;
SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
/**
* Overriding the SwatchBasedEditorTooltip.show function to set spectrum's
* color.
*/
show: function() {
// Call then parent class' show function
SwatchBasedEditorTooltip.prototype.show.call(this);
// Then set spectrum's color and listen to color changes to preview them
if (this.activeSwatch) {
this.currentSwatchColor = this.activeSwatch.nextSibling;
this._originalColor = this.currentSwatchColor.textContent;
let color = this.activeSwatch.style.backgroundColor;
this.spectrum.then(spectrum => {
spectrum.off("changed", this._onSpectrumColorChange);
spectrum.rgb = this._colorToRgba(color);
spectrum.on("changed", this._onSpectrumColorChange);
spectrum.updateUI();
});
}
let tooltipDoc = this.tooltip.content.contentDocument;
let eyeButton = tooltipDoc.querySelector("#eyedropper-button");
eyeButton.addEventListener("click", this._openEyeDropper);
},
_onSpectrumColorChange: function(event, rgba, cssColor) {
this._selectColor(cssColor);
},
_selectColor: function(color) {
if (this.activeSwatch) {
this.activeSwatch.style.backgroundColor = color;
this.activeSwatch.parentNode.dataset.color = color;
color = this._toDefaultType(color);
this.currentSwatchColor.textContent = color;
this.preview(color);
if (this.eyedropperOpen) {
this.commit();
}
}
},
_openEyeDropper: function() {
let chromeWindow = this.tooltip.doc.defaultView.top;
let windowType = chromeWindow.document.documentElement
.getAttribute("windowtype");
let toolboxWindow;
if (windowType != "navigator:browser") {
// this means the toolbox is in a seperate window. We need to make
// sure we'll be inspecting the browser window instead
toolboxWindow = chromeWindow;
chromeWindow = Services.wm.getMostRecentWindow("navigator:browser");
chromeWindow.focus();
}
let dropper = new Eyedropper(chromeWindow, { copyOnSelect: false,
context: "picker" });
dropper.once("select", (event, color) => {
if (toolboxWindow) {
toolboxWindow.focus();
}
this._selectColor(color);
});
dropper.once("destroy", () => {
this.eyedropperOpen = false;
this.activeSwatch = null;
});
dropper.open();
this.eyedropperOpen = true;
// close the colorpicker tooltip so that only the eyedropper is open.
this.hide();
this.tooltip.emit("eyedropper-opened", dropper);
},
_colorToRgba: function(color) {
color = new colorUtils.CssColor(color);
let rgba = color._getRGBATuple();
return [rgba.r, rgba.g, rgba.b, rgba.a];
},
_toDefaultType: function(color) {
let colorObj = new colorUtils.CssColor(color);
colorObj.setAuthoredUnitFromColor(this._originalColor);
return colorObj.toString();
},
destroy: function() {
SwatchBasedEditorTooltip.prototype.destroy.call(this);
this.currentSwatchColor = null;
this.spectrum.then(spectrum => {
spectrum.off("changed", this._onSpectrumColorChange);
spectrum.destroy();
});
}
});
function EventTooltip(tooltip, eventListenerInfos, toolbox) {
this._tooltip = tooltip;
this._eventListenerInfos = eventListenerInfos;
this._toolbox = toolbox;
this._tooltip.eventEditors = new WeakMap();
this._headerClicked = this._headerClicked.bind(this);
this._debugClicked = this._debugClicked.bind(this);
this.destroy = this.destroy.bind(this);
this._init();
}
EventTooltip.prototype = {
_init: function() {
let config = {
mode: Editor.modes.js,
lineNumbers: false,
lineWrapping: false,
readOnly: true,
styleActiveLine: true,
extraKeys: {},
theme: "mozilla markup-view"
};
let doc = this._tooltip.doc;
let container = doc.createElement("vbox");
container.setAttribute("id", "devtools-tooltip-events-container");
for (let listener of this._eventListenerInfos) {
let phase = listener.capturing ? "Capturing" : "Bubbling";
let level = listener.DOM0 ? "DOM0" : "DOM2";
// Header
let header = doc.createElement("hbox");
header.className = "event-header devtools-toolbar";
container.appendChild(header);
if (!listener.hide.debugger) {
let debuggerIcon = doc.createElement("image");
debuggerIcon.className = "event-tooltip-debugger-icon";
debuggerIcon.setAttribute("src", "chrome://devtools/skin/themes/images/tool-debugger.svg");
let openInDebugger =
l10n.strings.GetStringFromName("eventsTooltip.openInDebugger");
debuggerIcon.setAttribute("tooltiptext", openInDebugger);
header.appendChild(debuggerIcon);
}
if (!listener.hide.type) {
let eventTypeLabel = doc.createElement("label");
eventTypeLabel.className = "event-tooltip-event-type";
eventTypeLabel.setAttribute("value", listener.type);
eventTypeLabel.setAttribute("tooltiptext", listener.type);
header.appendChild(eventTypeLabel);
}
if (!listener.hide.filename) {
let filename = doc.createElement("label");
filename.className = "event-tooltip-filename devtools-monospace";
filename.setAttribute("value", listener.origin);
filename.setAttribute("tooltiptext", listener.origin);
filename.setAttribute("crop", "left");
header.appendChild(filename);
}
let attributesContainer = doc.createElement("hbox");
attributesContainer.setAttribute("class",
"event-tooltip-attributes-container");
header.appendChild(attributesContainer);
if (!listener.hide.capturing) {
let attributesBox = doc.createElement("box");
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
attributesContainer.appendChild(attributesBox);
let capturing = doc.createElement("label");
capturing.className = "event-tooltip-attributes";
capturing.setAttribute("value", phase);
capturing.setAttribute("tooltiptext", phase);
attributesBox.appendChild(capturing);
}
if (listener.tags) {
for (let tag of listener.tags.split(",")) {
let attributesBox = doc.createElement("box");
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
attributesContainer.appendChild(attributesBox);
let tagBox = doc.createElement("label");
tagBox.className = "event-tooltip-attributes";
tagBox.setAttribute("value", tag);
tagBox.setAttribute("tooltiptext", tag);
attributesBox.appendChild(tagBox);
}
}
if (!listener.hide.dom0) {
let attributesBox = doc.createElement("box");
attributesBox.setAttribute("class", "event-tooltip-attributes-box");
attributesContainer.appendChild(attributesBox);
let dom0 = doc.createElement("label");
dom0.className = "event-tooltip-attributes";
dom0.setAttribute("value", level);
dom0.setAttribute("tooltiptext", level);
attributesBox.appendChild(dom0);
}
// Content
let content = doc.createElement("box");
let editor = new Editor(config);
this._tooltip.eventEditors.set(content, {
editor: editor,
handler: listener.handler,
searchString: listener.searchString,
uri: listener.origin,
dom0: listener.DOM0,
appended: false
});
content.className = "event-tooltip-content-box";
container.appendChild(content);
this._addContentListeners(header);
}
this._tooltip.content = container;
this._tooltip.panel.setAttribute("clamped-dimensions-no-max-or-min-height",
"");
this._tooltip.panel.setAttribute("wide", "");
this._tooltip.panel.addEventListener("popuphiding", () => {
this.destroy(container);
}, false);
},
_addContentListeners: function(header) {
header.addEventListener("click", this._headerClicked);
},
_headerClicked: function(event) {
if (event.target.classList.contains("event-tooltip-debugger-icon")) {
this._debugClicked(event);
event.stopPropagation();
return;
}
let doc = this._tooltip.doc;
let header = event.currentTarget;
let content = header.nextElementSibling;
if (content.hasAttribute("open")) {
content.removeAttribute("open");
} else {
let contentNodes = doc.querySelectorAll(".event-tooltip-content-box");
for (let node of contentNodes) {
if (node !== content) {
node.removeAttribute("open");
}
}
content.setAttribute("open", "");
let eventEditors = this._tooltip.eventEditors.get(content);
if (eventEditors.appended) {
return;
}
let {editor, handler} = eventEditors;
let iframe = doc.createElement("iframe");
iframe.setAttribute("style", "width:100%;");
editor.appendTo(content, iframe).then(() => {
let tidied = beautify.js(handler, { indent_size: 2 });
editor.setText(tidied);
eventEditors.appended = true;
let container = header.parentElement.getBoundingClientRect();
if (header.getBoundingClientRect().top < container.top) {
header.scrollIntoView(true);
} else if (content.getBoundingClientRect().bottom > container.bottom) {
content.scrollIntoView(false);
}
this._tooltip.emit("event-tooltip-ready");
});
}
},
_debugClicked: function(event) {
let header = event.currentTarget;
let content = header.nextElementSibling;
let {uri, searchString, dom0} =
this._tooltip.eventEditors.get(content);
if (uri && uri !== "?") {
// Save a copy of toolbox as it will be set to null when we hide the
// tooltip.
let toolbox = this._toolbox;
this._tooltip.hide();
uri = uri.replace(/"/g, "");
let showSource = ({ DebuggerView }) => {
let matches = uri.match(/(.*):(\d+$)/);
let line = 1;
if (matches) {
uri = matches[1];
line = matches[2];
}
let item = DebuggerView.Sources.getItemForAttachment(
a => a.source.url === uri
);
if (item) {
let actor = item.attachment.source.actor;
DebuggerView.setEditorLocation(actor, line, {noDebug: true}).then(() => {
if (dom0) {
let text = DebuggerView.editor.getText();
let index = text.indexOf(searchString);
let lastIndex = text.lastIndexOf(searchString);
// To avoid confusion we only search for DOM0 event handlers when
// there is only one possible match in the file.
if (index !== -1 && index === lastIndex) {
text = text.substr(0, index);
let newlineMatches = text.match(/\n/g);
if (newlineMatches) {
DebuggerView.editor.setCursor({
line: newlineMatches.length
});
}
}
}
});
}
};
let debuggerAlreadyOpen = toolbox.getPanel("jsdebugger");
toolbox.selectTool("jsdebugger").then(({ panelWin: dbg }) => {
if (debuggerAlreadyOpen) {
showSource(dbg);
} else {
dbg.once(dbg.EVENTS.SOURCES_ADDED, () => showSource(dbg));
}
});
}
},
destroy: function(container) {
if (this._tooltip) {
this._tooltip.panel.removeEventListener("popuphiding", this.destroy,
false);
let boxes = container.querySelectorAll(".event-tooltip-content-box");
for (let box of boxes) {
let {editor} = this._tooltip.eventEditors.get(box);
editor.destroy();
}
this._tooltip.eventEditors.clear();
this._tooltip.eventEditors = null;
}
let headerNodes = container.querySelectorAll(".event-header");
for (let node of headerNodes) {
node.removeEventListener("click", this._headerClicked);
}
let sourceNodes =
container.querySelectorAll(".event-tooltip-debugger-icon");
for (let node of sourceNodes) {
node.removeEventListener("click", this._debugClicked);
}
this._eventListenerInfos = this._toolbox = this._tooltip = null;
}
};
/**
* The swatch cubic-bezier tooltip class is a specific class meant to be used
* along with rule-view's generated cubic-bezier swatches.
* It extends the parent SwatchBasedEditorTooltip class.
* It just wraps a standard Tooltip and sets its content with an instance of a
* CubicBezierWidget.
*
* @param {XULDocument} doc
*/
function SwatchCubicBezierTooltip(doc) {
SwatchBasedEditorTooltip.call(this, doc);
// Creating a cubic-bezier instance.
// this.widget will always be a promise that resolves to the widget instance
this.widget = this.tooltip.setCubicBezierContent([0, 0, 1, 1]);
this._onUpdate = this._onUpdate.bind(this);
}
module.exports.SwatchCubicBezierTooltip = SwatchCubicBezierTooltip;
SwatchCubicBezierTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
/**
* Overriding the SwatchBasedEditorTooltip.show function to set the cubic
* bezier curve in the widget
*/
show: function() {
// Call the parent class' show function
SwatchBasedEditorTooltip.prototype.show.call(this);
// Then set the curve and listen to changes to preview them
if (this.activeSwatch) {
this.currentBezierValue = this.activeSwatch.nextSibling;
this.widget.then(widget => {
widget.off("updated", this._onUpdate);
widget.cssCubicBezierValue = this.currentBezierValue.textContent;
widget.on("updated", this._onUpdate);
});
}
},
_onUpdate: function(event, bezier) {
if (!this.activeSwatch) {
return;
}
this.currentBezierValue.textContent = bezier + "";
this.preview(bezier + "");
},
destroy: function() {
SwatchBasedEditorTooltip.prototype.destroy.call(this);
this.currentBezierValue = null;
this.widget.then(widget => {
widget.off("updated", this._onUpdate);
widget.destroy();
});
}
});
/**
* Tooltip for displaying docs for CSS properties from MDN.
*
* @param {XULDocument} doc
*/
function CssDocsTooltip(doc) {
this.tooltip = new Tooltip(doc, {
consumeOutsideClick: true,
closeOnKeys: [ESCAPE_KEYCODE, RETURN_KEYCODE],
noAutoFocus: false
});
this.widget = this.tooltip.setMdnDocsContent();
}
module.exports.CssDocsTooltip = CssDocsTooltip;
CssDocsTooltip.prototype = {
/**
* Load CSS docs for the given property,
* then display the tooltip.
*/
show: function(anchor, propertyName) {
function loadCssDocs(widget) {
return widget.loadCssDocs(propertyName);
}
this.widget.then(loadCssDocs);
this.tooltip.show(anchor, "topcenter bottomleft");
},
hide: function() {
this.tooltip.hide();
},
destroy: function() {
this.tooltip.destroy();
}
};
/**
* The swatch-based css filter tooltip class is a specific class meant to be
* used along with rule-view's generated css filter swatches.
* It extends the parent SwatchBasedEditorTooltip class.
* It just wraps a standard Tooltip and sets its content with an instance of a
* CSSFilterEditorWidget.
*
* @param {XULDocument} doc
*/
function SwatchFilterTooltip(doc) {
SwatchBasedEditorTooltip.call(this, doc);
// Creating a filter editor instance.
// this.widget will always be a promise that resolves to the widget instance
this.widget = this.tooltip.setFilterContent("none");
this._onUpdate = this._onUpdate.bind(this);
}
exports.SwatchFilterTooltip = SwatchFilterTooltip;
SwatchFilterTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
show: function() {
// Call the parent class' show function
SwatchBasedEditorTooltip.prototype.show.call(this);
// Then set the filter value and listen to changes to preview them
if (this.activeSwatch) {
this.currentFilterValue = this.activeSwatch.nextSibling;
this.widget.then(widget => {
widget.off("updated", this._onUpdate);
widget.on("updated", this._onUpdate);
widget.setCssValue(this.currentFilterValue.textContent);
widget.render();
});
}
},
_onUpdate: function(event, filters) {
if (!this.activeSwatch) {
return;
}
// Remove the old children and reparse the property value to
// recompute them.
while (this.currentFilterValue.firstChild) {
this.currentFilterValue.firstChild.remove();
}
let node = this._parser.parseCssProperty("filter", filters, this._options);
this.currentFilterValue.appendChild(node);
this.preview();
},
destroy: function() {
SwatchBasedEditorTooltip.prototype.destroy.call(this);
this.currentFilterValue = null;
this.widget.then(widget => {
widget.off("updated", this._onUpdate);
widget.destroy();
});
},
/**
* Like SwatchBasedEditorTooltip.addSwatch, but accepts a parser object
* to use when previewing the updated property value.
*
* @param {node} swatchEl
* @see SwatchBasedEditorTooltip.addSwatch
* @param {object} callbacks
* @see SwatchBasedEditorTooltip.addSwatch
* @param {object} parser
* A parser object; @see OutputParser object
* @param {object} options
* options to pass to the output parser, with
* the option |filterSwatch| set.
*/
addSwatch: function(swatchEl, callbacks, parser, options) {
SwatchBasedEditorTooltip.prototype.addSwatch.call(this, swatchEl,
callbacks);
this._parser = parser;
this._options = options;
}
});
/**
* L10N utility class
*/
function L10N() {}
L10N.prototype = {};
var l10n = new L10N();
loader.lazyGetter(L10N.prototype, "strings", () => {
return Services.strings.createBundle(
"chrome://browser/locale/devtools/inspector.properties");
});